EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26O6 |
| Net Charge | 0 |
| Average Mass | 398.455 |
| Monoisotopic Mass | 398.17294 |
| SMILES | CCOC1OC(/C(C)=C/C(C)CC)=Cc2cc3c(c(O)c21)C(=O)C(=O)C(OC)=C3 |
| InChI | InChI=1S/C23H26O6/c1-6-12(3)8-13(4)16-10-15-9-14-11-17(27-5)20(24)22(26)18(14)21(25)19(15)23(29-16)28-7-2/h8-12,23,25H,6-7H2,1-5H3/b13-8+ |
| InChIKey | UMMLLCGZZRNVRG-MDWZMJQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Laccaria amethystea (ncbitaxon:213150) | - | PubMed (11213295) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. protease inhibitor A compound which inhibits or antagonizes the biosynthesis or actions of proteases (endopeptidases). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| laccaridione B (CHEBI:66541) has role metabolite (CHEBI:25212) |
| laccaridione B (CHEBI:66541) has role protease inhibitor (CHEBI:37670) |
| laccaridione B (CHEBI:66541) is a cyclic acetal (CHEBI:59770) |
| laccaridione B (CHEBI:66541) is a enol ether (CHEBI:47985) |
| laccaridione B (CHEBI:66541) is a isochromenes (CHEBI:38761) |
| laccaridione B (CHEBI:66541) is a organic heterotricyclic compound (CHEBI:26979) |
| laccaridione B (CHEBI:66541) is a orthoquinones (CHEBI:25622) |
| laccaridione B (CHEBI:66541) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 1-ethoxy-10-hydroxy-7-methoxy-3-[(2E)-4-methylhex-2-en-2-yl]-1H-benzo[g]isochromene-8,9-dione |
| Manual Xrefs | Databases |
|---|---|
| DE10037982 | Patent |
| DE10349511 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8726721 | Reaxys |
| Citations |
|---|