EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26O6 |
| Net Charge | 0 |
| Average Mass | 398.455 |
| Monoisotopic Mass | 398.17294 |
| SMILES | CCOC1OC(/C(C)=C/C(C)CC)=Cc2cc3c(c(O)c21)C(=O)C(=O)C(OC)=C3 |
| InChI | InChI=1S/C23H26O6/c1-6-12(3)8-13(4)16-10-15-9-14-11-17(27-5)20(24)22(26)18(14)21(25)19(15)23(29-16)28-7-2/h8-12,23,25H,6-7H2,1-5H3/b13-8+ |
| InChIKey | UMMLLCGZZRNVRG-MDWZMJQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Laccaria amethystea (ncbitaxon:213150) | - | PubMed (11213295) |
| Roles Classification |
|---|
| Biological Roles: | protease inhibitor A compound which inhibits or antagonizes the biosynthesis or actions of proteases (endopeptidases). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| laccaridione B (CHEBI:66541) has role metabolite (CHEBI:25212) |
| laccaridione B (CHEBI:66541) has role protease inhibitor (CHEBI:37670) |
| laccaridione B (CHEBI:66541) is a cyclic acetal (CHEBI:59770) |
| laccaridione B (CHEBI:66541) is a enol ether (CHEBI:47985) |
| laccaridione B (CHEBI:66541) is a isochromenes (CHEBI:38761) |
| laccaridione B (CHEBI:66541) is a organic heterotricyclic compound (CHEBI:26979) |
| laccaridione B (CHEBI:66541) is a orthoquinones (CHEBI:25622) |
| laccaridione B (CHEBI:66541) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 1-ethoxy-10-hydroxy-7-methoxy-3-[(2E)-4-methylhex-2-en-2-yl]-1H-benzo[g]isochromene-8,9-dione |
| Manual Xrefs | Databases |
|---|---|
| DE10349511 | Patent |
| DE10037982 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8726721 | Reaxys |
| Citations |
|---|