EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H26O17 |
| Net Charge | 0 |
| Average Mass | 694.554 |
| Monoisotopic Mass | 694.11700 |
| SMILES | COc1cc(O)c2c(=O)c3c(O)c(-c4c(O)c([C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)c(O)c5c(=O)c6cc(O)c(O)cc6oc45)cc(O)c3oc2c1 |
| InChI | InChI=1S/C33H26O17/c1-47-8-2-13(37)19-16(3-8)49-31-14(38)5-10(24(40)20(31)27(19)43)18-26(42)22(33-30(46)29(45)25(41)17(7-34)50-33)28(44)21-23(39)9-4-11(35)12(36)6-15(9)48-32(18)21/h2-6,17,25,29-30,33-38,40-42,44-46H,7H2,1H3/t17-,25-,29+,30-,33+/m1/s1 |
| InChIKey | GNMLPEJAIRBAAO-FLJAPRSHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Swertia punicea (ncbitaxon:137131) | whole plant (BTO:0001461) | DOI (10.1021/jo00025a032) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| swertipunicoside (CHEBI:66538) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| swertipunicoside (CHEBI:66538) has role metabolite (CHEBI:25212) |
| swertipunicoside (CHEBI:66538) is a C-glycosyl compound (CHEBI:20857) |
| swertipunicoside (CHEBI:66538) is a aromatic ether (CHEBI:35618) |
| swertipunicoside (CHEBI:66538) is a biaryl (CHEBI:64459) |
| swertipunicoside (CHEBI:66538) is a polyphenol (CHEBI:26195) |
| swertipunicoside (CHEBI:66538) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-(1,1',3',4,6',7',8-heptahydroxy-6-methoxy-9,9'-dioxo-9H,9'H-2,4'-bixanthen-2'-yl)-D-glucitol |
| Synonym | Source |
|---|---|
| 1,5,8-trihydroxy-3-methoxy-7-(1',3',6',7'-tetrahydroxy-9'-oxo-4'-xanthyl)xanthone-2'-C-β-D-glucopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5372848 | Reaxys |
| CAS:137570-21-9 | ChemIDplus |
| Citations |
|---|