EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H28O17 |
| Net Charge | 0 |
| Average Mass | 720.592 |
| Monoisotopic Mass | 720.13265 |
| SMILES | COc1cc(O)c2c(=O)c3c(O)c(-c4c(O)c([C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)c(O)c5c(=O)cc(-c6ccc(O)c(O)c6)oc45)cc(O)c3oc2c1 |
| InChI | InChI=1S/C35H28O17/c1-49-11-5-15(39)22-19(6-11)51-33-17(41)7-12(26(42)24(33)29(22)45)21-28(44)25(35-32(48)31(47)27(43)20(9-36)52-35)30(46)23-16(40)8-18(50-34(21)23)10-2-3-13(37)14(38)4-10/h2-8,20,27,31-32,35-39,41-44,46-48H,9H2,1H3/t20-,27-,31+,32-,35+/m1/s1 |
| InChIKey | JAANJQNFIJSRTK-KYRPIRIWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Swertia franchetiana (ncbitaxon:50785) | - | PubMed (7513747) |
| Roles Classification |
|---|
| Biological Roles: | EC 6.5.1.1 [DNA ligase (ATP)] inhibitor An EC 6.5.1.* (DNA/RNA repair enzymes) inhibitor that interferes with the action of DNA ligase (ATP), EC 6.5.1.1. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| swertifrancheside (CHEBI:66537) has role EC 6.5.1.1 [DNA ligase (ATP)] inhibitor (CHEBI:64920) |
| swertifrancheside (CHEBI:66537) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| swertifrancheside (CHEBI:66537) has role metabolite (CHEBI:25212) |
| swertifrancheside (CHEBI:66537) is a C-glycosyl compound (CHEBI:20857) |
| swertifrancheside (CHEBI:66537) is a biaryl (CHEBI:64459) |
| swertifrancheside (CHEBI:66537) is a tetrahydroxyflavone (CHEBI:38684) |
| swertifrancheside (CHEBI:66537) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-8-(1,4,8-trihydroxy-6-methoxy-9-oxo-9H-xanthen-2-yl)-4H-chromen-6-yl]-D-glucitol |
| Synonym | Source |
|---|---|
| 1,5,8-trihydroxy-3-methoxy-7-(5',7',3'',4''-tetrahydroxy-6'-C-β-D-glucopyranosyl-4'-oxy-8'-flavyl)xanthone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:155740-03-7 | ChemIDplus |
| Citations |
|---|