EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H28O17 |
| Net Charge | 0 |
| Average Mass | 720.592 |
| Monoisotopic Mass | 720.13265 |
| SMILES | COc1cc(O)c2c(=O)c3c(O)c(-c4c(O)c([C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)c(O)c5c(=O)cc(-c6ccc(O)c(O)c6)oc45)cc(O)c3oc2c1 |
| InChI | InChI=1S/C35H28O17/c1-49-11-5-15(39)22-19(6-11)51-33-17(41)7-12(26(42)24(33)29(22)45)21-28(44)25(35-32(48)31(47)27(43)20(9-36)52-35)30(46)23-16(40)8-18(50-34(21)23)10-2-3-13(37)14(38)4-10/h2-8,20,27,31-32,35-39,41-44,46-48H,9H2,1H3/t20-,27-,31+,32-,35+/m1/s1 |
| InChIKey | JAANJQNFIJSRTK-KYRPIRIWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Swertia franchetiana (ncbitaxon:50785) | - | PubMed (7513747) |
| Roles Classification |
|---|
| Biological Roles: | EC 6.5.1.1 [DNA ligase (ATP)] inhibitor An EC 6.5.1.* (DNA/RNA repair enzymes) inhibitor that interferes with the action of DNA ligase (ATP), EC 6.5.1.1. HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| swertifrancheside (CHEBI:66537) has role EC 6.5.1.1 [DNA ligase (ATP)] inhibitor (CHEBI:64920) |
| swertifrancheside (CHEBI:66537) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| swertifrancheside (CHEBI:66537) has role metabolite (CHEBI:25212) |
| swertifrancheside (CHEBI:66537) is a C-glycosyl compound (CHEBI:20857) |
| swertifrancheside (CHEBI:66537) is a biaryl (CHEBI:64459) |
| swertifrancheside (CHEBI:66537) is a tetrahydroxyflavone (CHEBI:38684) |
| swertifrancheside (CHEBI:66537) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-8-(1,4,8-trihydroxy-6-methoxy-9-oxo-9H-xanthen-2-yl)-4H-chromen-6-yl]-D-glucitol |
| Synonym | Source |
|---|---|
| 1,5,8-trihydroxy-3-methoxy-7-(5',7',3'',4''-tetrahydroxy-6'-C-β-D-glucopyranosyl-4'-oxy-8'-flavyl)xanthone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:155740-03-7 | ChemIDplus |
| Citations |
|---|