EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N2O4 |
| Net Charge | 0 |
| Average Mass | 212.205 |
| Monoisotopic Mass | 212.07971 |
| SMILES | Cc1cc(C(=O)NCCC(=O)O)n(O)c1 |
| InChI | InChI=1S/C9H12N2O4/c1-6-4-7(11(15)5-6)9(14)10-3-2-8(12)13/h4-5,15H,2-3H2,1H3,(H,10,14)(H,12,13) |
| InChIKey | FOPVYEUKBVIKFE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (19129624) | Strain: USF 6280 |
| Roles Classification |
|---|
| Chemical Roles: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| surugapyrrole A (CHEBI:66534) has role metabolite (CHEBI:25212) |
| surugapyrrole A (CHEBI:66534) has role radical scavenger (CHEBI:48578) |
| surugapyrrole A (CHEBI:66534) is a N-hydroxypyrrole (CHEBI:68839) |
| surugapyrrole A (CHEBI:66534) is a monocarboxylic acid (CHEBI:25384) |
| surugapyrrole A (CHEBI:66534) is a pyrrolecarboxamide (CHEBI:48611) |
| surugapyrrole A (CHEBI:66534) is a β-alanine derivative (CHEBI:22823) |
| IUPAC Name |
|---|
| N-[(1-hydroxy-4-methyl-1H-pyrrol-2-yl)carbonyl]-β-alanine |
| Synonym | Source |
|---|---|
| 3-{[(1-hydroxy-4-methyl-1H-pyrrol-2-yl)carbonyl]amino}propanoic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19111081 | Reaxys |
| Citations |
|---|