EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H34O18 |
| Net Charge | 0 |
| Average Mass | 706.606 |
| Monoisotopic Mass | 706.17451 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@H]1[C@@H](C(O)CO)OC(C(=O)O)=C[C@H]1OC(=O)/C=C/c1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(O)c1 |
| InChI | InChI=1S/C32H34O18/c33-12-19(38)29-30(50-25(40)8-4-14-1-5-16(35)17(36)9-14)21(11-22(47-29)31(44)45)46-24(39)7-3-15-2-6-20(18(37)10-15)48-32-28(43)27(42)26(41)23(13-34)49-32/h1-11,19,21,23,26-30,32-38,41-43H,12-13H2,(H,44,45)/b7-3+,8-4+/t19?,21-,23-,26-,27+,28-,29-,30-,32-/m1/s1 |
| InChIKey | LMMUFUFTSHITNC-YJGIVPHDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scapania parvitexta (ncbitaxon:41847) | - | PubMed (11999396) | |
| Jungermannia subulata (ncbitaxon:3203) | - | PubMed (11999396) | |
| Lophocolea heterophylla (ncbitaxon:3207) | - | PubMed (11999396) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| subulatin (CHEBI:66533) has functional parent trans-caffeic acid (CHEBI:16433) |
| subulatin (CHEBI:66533) has role antioxidant (CHEBI:22586) |
| subulatin (CHEBI:66533) has role metabolite (CHEBI:25212) |
| subulatin (CHEBI:66533) is a alkyl caffeate ester (CHEBI:65331) |
| subulatin (CHEBI:66533) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2,6-anhydro-3-deoxy-6-(1,2-dihydroxyethyl)-5-O-[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-4-O-{(2E)-3-[4-(β-D-glucopyranosyloxy)-3-hydroxyphenyl]prop-2-enoyl}-L-erythro-hex-2-enonic acid |
| Citations |
|---|