EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H38O3 |
| Net Charge | 0 |
| Average Mass | 410.598 |
| Monoisotopic Mass | 410.28210 |
| SMILES | [H][C@@]12CCC(C)=C(CC/C(C)=C/Cc3cc(C(=O)O)ccc3O)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C27H38O3/c1-18(7-10-20-17-21(25(29)30)11-13-23(20)28)8-12-22-19(2)9-14-24-26(3,4)15-6-16-27(22,24)5/h7,11,13,17,24,28H,6,8-10,12,14-16H2,1-5H3,(H,29,30)/b18-7+/t24-,27+/m0/s1 |
| InChIKey | RIYHRKNIDKXDII-UEKCLBEQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acanthodendrilla (ncbitaxon:558782) | - | PubMed (15620270) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. protein kinase inhibitor An EC 2.7.* (P-containing group transferase) inhibitor that interferes with the action of protein kinases. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-subersic acid (CHEBI:66532) has role anti-inflammatory agent (CHEBI:67079) |
| (+)-subersic acid (CHEBI:66532) has role metabolite (CHEBI:25212) |
| (+)-subersic acid (CHEBI:66532) has role protein kinase inhibitor (CHEBI:37699) |
| (+)-subersic acid (CHEBI:66532) is a carbobicyclic compound (CHEBI:36785) |
| (+)-subersic acid (CHEBI:66532) is a meroterpenoid (CHEBI:64419) |
| (+)-subersic acid (CHEBI:66532) is a monohydroxybenzoic acid (CHEBI:25389) |
| (+)-subersic acid (CHEBI:66532) is a octahydronaphthalenes (CHEBI:138397) |
| IUPAC Name |
|---|
| 4-hydroxy-3-{(2E)-3-methyl-5-[(4aS,8aS)-2,5,5,8a-tetramethyl-3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]pent-2-en-1-yl}benzoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9817280 | Reaxys |
| Citations |
|---|