EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H50O2 |
| Net Charge | 0 |
| Average Mass | 454.739 |
| Monoisotopic Mass | 454.38108 |
| SMILES | [H][C@@]12CC=C3C(=CC[C@]4(C)[C@@]([H])([C@H](C)CCC(=C)C(C)C)C[C@H](O)[C@@]34C)[C@@]1(C)CC[C@H](O)C2(C)C |
| InChI | InChI=1S/C31H50O2/c1-19(2)20(3)10-11-21(4)24-18-27(33)31(9)23-12-13-25-28(5,6)26(32)15-16-29(25,7)22(23)14-17-30(24,31)8/h12,14,19,21,24-27,32-33H,3,10-11,13,15-18H2,1-2,4-9H3/t21-,24-,25+,26+,27+,29-,30-,31-/m1/s1 |
| InChIKey | MJRURUDEESYVHI-UJZFCZBUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Polyalthia suberosa (ncbitaxon:105757) | |||
| stem (BTO:0001300) | PubMed (8377018) | ||
| leaf (BTO:0000713) | PubMed (8377018) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| suberosol (CHEBI:66531) has parent hydride lanostane (CHEBI:20265) |
| suberosol (CHEBI:66531) has role anti-HIV agent (CHEBI:64946) |
| suberosol (CHEBI:66531) has role metabolite (CHEBI:25212) |
| suberosol (CHEBI:66531) is a diol (CHEBI:23824) |
| suberosol (CHEBI:66531) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (3β,15α)-24-methylidenelanosta-7,9(11)-diene-3,15-diol |
| Citations |
|---|