EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H31NO2 |
| Net Charge | 0 |
| Average Mass | 353.506 |
| Monoisotopic Mass | 353.23548 |
| SMILES | CC(C)=C1CC[C@@H](C)[C@@](C)(Cc2cnc3ccccc23)[C@@H]1CCC(=O)O |
| InChI | InChI=1S/C23H31NO2/c1-15(2)18-10-9-16(3)23(4,20(18)11-12-22(25)26)13-17-14-24-21-8-6-5-7-19(17)21/h5-8,14,16,20,24H,9-13H2,1-4H3,(H,25,26)/t16-,20-,23-/m1/s1 |
| InChIKey | GVPCTDRGYRLXLX-AYPBNUJASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Greenwayodendron suaveolens (ncbitaxon:235734) | fruit (BTO:0000486) | PubMed (15679334) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| suaveolindole (CHEBI:66530) has role antibacterial agent (CHEBI:33282) |
| suaveolindole (CHEBI:66530) has role metabolite (CHEBI:25212) |
| suaveolindole (CHEBI:66530) is a monocarboxylic acid (CHEBI:25384) |
| suaveolindole (CHEBI:66530) is a sesquiterpenoid (CHEBI:26658) |
| suaveolindole (CHEBI:66530) is a terpenoid indole alkaloid (CHEBI:65321) |
| IUPAC Name |
|---|
| 3-[(1S,2R,3R)-2-(1H-indol-3-ylmethyl)-2,3-dimethyl-6-(propan-2-ylidene)cyclohexyl]propanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11253440 | Reaxys |
| Citations |
|---|