EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H42N4O4 |
| Net Charge | 0 |
| Average Mass | 666.822 |
| Monoisotopic Mass | 666.32061 |
| SMILES | [H][C@]12C=C([C@H]3C[C@@]45c6ccccc6N6C(=O)C[C@]7([H])OCC=C8CN3[C@@]4([H])C[C@]8([H])[C@]7([H])[C@]65[H])C(=O)N3c4ccccc4[C@@]4(CCN5C/C(=C/CO)[C@]1([H])C[C@]54[H])[C@@]32[H] |
| InChI | InChI=1S/C42H42N4O4/c47-13-9-22-20-43-12-11-41-28-5-1-4-8-31(28)46-38(41)26(24(22)16-34(41)43)15-27(40(46)49)32-19-42-29-6-2-3-7-30(29)45-36(48)18-33-37(39(42)45)25-17-35(42)44(32)21-23(25)10-14-50-33/h1-10,15,24-26,32-35,37-39,47H,11-14,16-21H2/b22-9-/t24-,25-,26-,32+,33-,34-,35-,37-,38-,39-,41+,42+/m0/s1 |
| InChIKey | MMKIAHOGFMPKCT-LUNGMMDTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Strychnos icaja (ncbitaxon:1040889) | root (BTO:0001188) | PubMed (11170658) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| strychnogucine B (CHEBI:66529) has role antiplasmodial drug (CHEBI:64915) |
| strychnogucine B (CHEBI:66529) has role metabolite (CHEBI:25212) |
| strychnogucine B (CHEBI:66529) is a bisindole alkaloid (CHEBI:51879) |
| strychnogucine B (CHEBI:66529) is a primary alcohol (CHEBI:15734) |
| strychnogucine B (CHEBI:66529) is a ring assembly (CHEBI:36820) |
| IUPAC Name |
|---|
| (18α)-18-[(3aR,11aS,11bS,12R,13aS,14E)-14-(2-hydroxyethylidene)-9-oxo-2,3,11a,12,13,13a-hexahydro-9H,11bH-1,12-ethanopyrido[1,2,3-lm]pyrrolo[2,3-d]carbazol-10-yl]strychnidin-10-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8820805 | Reaxys |
| Citations |
|---|