EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H36O6 |
| Net Charge | 0 |
| Average Mass | 456.579 |
| Monoisotopic Mass | 456.25119 |
| SMILES | [H][C@]12CC[C@](C)(O)[C@@H](CC3=CC(=O)C=C(OC)C3=O)[C@]1(C)CC[C@]1([H])[C@]23CCC[C@]1(C)C(=O)OC3 |
| InChI | InChI=1S/C27H36O6/c1-24-10-6-20-25(2)8-5-9-27(20,15-33-23(25)30)19(24)7-11-26(3,31)21(24)13-16-12-17(28)14-18(32-4)22(16)29/h12,14,19-21,31H,5-11,13,15H2,1-4H3/t19-,20-,21-,24+,25-,26-,27-/m0/s1 |
| InChIKey | AMOGVPDDGBDGJG-FOMYWIRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Petrosia corticata (WORMS:166869) | - | PubMed (17407351) | Lipophilic extract of the marine sponge Petrosia (Strongylophora) corticata |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| strongylophorine-26 (CHEBI:66527) has role animal metabolite (CHEBI:75767) |
| strongylophorine-26 (CHEBI:66527) has role antineoplastic agent (CHEBI:35610) |
| strongylophorine-26 (CHEBI:66527) has role marine metabolite (CHEBI:76507) |
| strongylophorine-26 (CHEBI:66527) is a p-quinones (CHEBI:25830) |
| strongylophorine-26 (CHEBI:66527) is a diterpenoid (CHEBI:23849) |
| strongylophorine-26 (CHEBI:66527) is a enol ether (CHEBI:47985) |
| strongylophorine-26 (CHEBI:66527) is a meroterpenoid (CHEBI:64419) |
| strongylophorine-26 (CHEBI:66527) is a tertiary alcohol (CHEBI:26878) |
| strongylophorine-26 (CHEBI:66527) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| 2-{[(13α,14β)-13-hydroxy-8,13-dimethyl-15-oxo-15,17-epoxypodocarpan-14-yl]methyl}-6-methoxycyclohexa-2,5-diene-1,4-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10738211 | Reaxys |
| Citations |
|---|