EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H36O6 |
| Net Charge | 0 |
| Average Mass | 456.579 |
| Monoisotopic Mass | 456.25119 |
| SMILES | [H][C@]12CC[C@](C)(O)[C@@H](CC3=CC(=O)C=C(OC)C3=O)[C@]1(C)CC[C@]1([H])[C@]23CCC[C@]1(C)C(=O)OC3 |
| InChI | InChI=1S/C27H36O6/c1-24-10-6-20-25(2)8-5-9-27(20,15-33-23(25)30)19(24)7-11-26(3,31)21(24)13-16-12-17(28)14-18(32-4)22(16)29/h12,14,19-21,31H,5-11,13,15H2,1-4H3/t19-,20-,21-,24+,25-,26-,27-/m0/s1 |
| InChIKey | AMOGVPDDGBDGJG-FOMYWIRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Petrosia corticata (WORMS:166869) | - | PubMed (17407351) | Lipophilic extract of the marine sponge Petrosia (Strongylophora) corticata |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| strongylophorine-26 (CHEBI:66527) has role animal metabolite (CHEBI:75767) |
| strongylophorine-26 (CHEBI:66527) has role antineoplastic agent (CHEBI:35610) |
| strongylophorine-26 (CHEBI:66527) has role marine metabolite (CHEBI:76507) |
| strongylophorine-26 (CHEBI:66527) is a p-quinones (CHEBI:25830) |
| strongylophorine-26 (CHEBI:66527) is a diterpenoid (CHEBI:23849) |
| strongylophorine-26 (CHEBI:66527) is a enol ether (CHEBI:47985) |
| strongylophorine-26 (CHEBI:66527) is a meroterpenoid (CHEBI:64419) |
| strongylophorine-26 (CHEBI:66527) is a tertiary alcohol (CHEBI:26878) |
| strongylophorine-26 (CHEBI:66527) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| 2-{[(13α,14β)-13-hydroxy-8,13-dimethyl-15-oxo-15,17-epoxypodocarpan-14-yl]methyl}-6-methoxycyclohexa-2,5-diene-1,4-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10738211 | Reaxys |
| Citations |
|---|