EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O3 |
| Net Charge | 0 |
| Average Mass | 344.495 |
| Monoisotopic Mass | 344.23514 |
| SMILES | [H][C@@]12CC[C@H](C)[C@@]3(C)Cc4c(OC)ccc(O)c4O[C@@]13CCCC2(C)C |
| InChI | InChI=1S/C22H32O3/c1-14-7-10-18-20(2,3)11-6-12-22(18)21(14,4)13-15-17(24-5)9-8-16(23)19(15)25-22/h8-9,14,18,23H,6-7,10-13H2,1-5H3/t14-,18-,21+,22-/m0/s1 |
| InChIKey | AHDRBWCUVQGBTR-DNEUNLEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Strongylophora hartmani (WORMS:194087) | - | PubMed (1791476) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. |
| Applications: | EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| strongylin A (CHEBI:66526) has role antineoplastic agent (CHEBI:35610) |
| strongylin A (CHEBI:66526) has role EC 3.2.1.18 (exo-α-sialidase) inhibitor (CHEBI:52425) |
| strongylin A (CHEBI:66526) has role metabolite (CHEBI:25212) |
| strongylin A (CHEBI:66526) is a aromatic ether (CHEBI:35618) |
| strongylin A (CHEBI:66526) is a organic heterotetracyclic compound (CHEBI:38163) |
| strongylin A (CHEBI:66526) is a phenols (CHEBI:33853) |
| strongylin A (CHEBI:66526) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (4aS,7S,7aR,13aS)-9-methoxy-4,4,7,7a-tetramethyl-1,2,3,4,4a,5,6,7,7a,8-decahydrobenzo[d]xanthen-12-ol |
| Registry Numbers | Sources |
|---|---|
| CAS:136978-48-8 | ChemIDplus |
| Citations |
|---|