EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21NO3 |
| Net Charge | 0 |
| Average Mass | 299.370 |
| Monoisotopic Mass | 299.15214 |
| SMILES | COc1c(C)c(C[C@@H](C)O)c2nc3ccccc3c2c1OC |
| InChI | InChI=1S/C18H21NO3/c1-10(20)9-13-11(2)17(21-3)18(22-4)15-12-7-5-6-8-14(12)19-16(13)15/h5-8,10,19-20H,9H2,1-4H3/t10-/m1/s1 |
| InChIKey | BSCARUQHRDHPML-SNVBAGLBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptoverticillium morookaense (ncbitaxon:1970) | - | PubMed (17446689) | Strain: SC1169 |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| streptoverticillin (CHEBI:66525) has parent hydride 9H-carbazole (CHEBI:27543) |
| streptoverticillin (CHEBI:66525) has role antifungal agent (CHEBI:35718) |
| streptoverticillin (CHEBI:66525) has role metabolite (CHEBI:25212) |
| streptoverticillin (CHEBI:66525) is a aromatic ether (CHEBI:35618) |
| streptoverticillin (CHEBI:66525) is a carbazole alkaloid (CHEBI:74510) |
| streptoverticillin (CHEBI:66525) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (2R)-1-(3,4-dimethoxy-2-methyl-9H-carbazol-1-yl)propan-2-ol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21969436 | Reaxys |
| Citations |
|---|