EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO2 |
| Net Charge | 0 |
| Average Mass | 151.165 |
| Monoisotopic Mass | 151.06333 |
| SMILES | CC(=O)c1cc(C)nc(=O)c1 |
| InChI | InChI=1S/C8H9NO2/c1-5-3-7(6(2)10)4-8(11)9-5/h3-4H,1-2H3,(H,9,11) |
| InChIKey | JCPDZXJDYRLFMC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (16830891) | Strain: KORDI 3238 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| streptokordin (CHEBI:66524) has role antimicrobial agent (CHEBI:33281) |
| streptokordin (CHEBI:66524) has role antineoplastic agent (CHEBI:35610) |
| streptokordin (CHEBI:66524) has role metabolite (CHEBI:25212) |
| streptokordin (CHEBI:66524) is a aromatic ketone (CHEBI:76224) |
| streptokordin (CHEBI:66524) is a methyl ketone (CHEBI:51867) |
| streptokordin (CHEBI:66524) is a pyridone (CHEBI:38183) |
| IUPAC Name |
|---|
| 4-acetyl-6-methylpyridin-2(1H)-one |
| Synonym | Source |
|---|---|
| 4-acetyl-6-methyl-1H-pyridine-2-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10530579 | Reaxys |
| Citations |
|---|