EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O3 |
| Net Charge | 0 |
| Average Mass | 416.646 |
| Monoisotopic Mass | 416.32905 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@@](C)(O)CCCC(C)(C)O |
| InChI | InChI=1S/C27H44O3/c1-24(2,29)13-6-14-27(5,30)23-10-9-21-20-8-7-18-17-19(28)11-15-25(18,3)22(20)12-16-26(21,23)4/h17,20-23,29-30H,6-16H2,1-5H3/t20-,21-,22-,23-,25-,26-,27-/m0/s1 |
| InChIKey | GEYCTESILRJHOA-RBNQBTAKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stachyurus himalaicus (ncbitaxon:167472) | - | PubMed (17851408) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stachsterol (CHEBI:66521) has role antineoplastic agent (CHEBI:35610) |
| stachsterol (CHEBI:66521) has role metabolite (CHEBI:25212) |
| stachsterol (CHEBI:66521) is a 20-hydroxy steroid (CHEBI:36854) |
| stachsterol (CHEBI:66521) is a 25-hydroxy steroid (CHEBI:36864) |
| stachsterol (CHEBI:66521) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| stachsterol (CHEBI:66521) is a cholestanoid (CHEBI:50401) |
| IUPAC Name |
|---|
| 20,25-dihydroxycholest-4-en-3-one |
| Synonym | Source |
|---|---|
| (20S)-20,25-dihydroxy-4-cholecten-3-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11024383 | Reaxys |
| Citations |
|---|