EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H36O3 |
| Net Charge | 0 |
| Average Mass | 408.582 |
| Monoisotopic Mass | 408.26645 |
| SMILES | [H][C@@]12[C@@H](CC)C(=O)[C@H](C)[C@@]1([H])C(CC)=C[C@](/C=C/c1ccccc1)(CC)[C@@]2(CC)C(=O)O |
| InChI | InChI=1S/C27H36O3/c1-6-20-17-26(8-3,16-15-19-13-11-10-12-14-19)27(9-4,25(29)30)23-21(7-2)24(28)18(5)22(20)23/h10-18,21-23H,6-9H2,1-5H3,(H,29,30)/b16-15+/t18-,21-,22+,23-,26-,27-/m1/s1 |
| InChIKey | ALLQJQBDLUMIQH-UOVLAWSHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Plakortis angulospiculatus (ncbitaxon:295227) | - | PubMed (14703354) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spiculoic acid A (CHEBI:66520) has role antineoplastic agent (CHEBI:35610) |
| spiculoic acid A (CHEBI:66520) has role metabolite (CHEBI:25212) |
| spiculoic acid A (CHEBI:66520) is a carbobicyclic compound (CHEBI:36785) |
| spiculoic acid A (CHEBI:66520) is a cyclic ketone (CHEBI:3992) |
| spiculoic acid A (CHEBI:66520) is a oxo monocarboxylic acid (CHEBI:35871) |
| spiculoic acid A (CHEBI:66520) is a styrenes (CHEBI:26799) |
| IUPAC Name |
|---|
| (1R,3R,3aS,4S,5R,7aS)-3,4,5,7-tetraethyl-1-methyl-2-oxo-5-[(E)-2-phenylethenyl]-2,3,3a,4,5,7a-hexahydro-1H-indene-4-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9666648 | Reaxys |
| Citations |
|---|