EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19NO6 |
| Net Charge | 0 |
| Average Mass | 345.351 |
| Monoisotopic Mass | 345.12124 |
| SMILES | CC(C)CC(=O)OC(c1ccccc1)c1cc(O)c(C(=O)O)c(=O)n1 |
| InChI | InChI=1S/C18H19NO6/c1-10(2)8-14(21)25-16(11-6-4-3-5-7-11)12-9-13(20)15(18(23)24)17(22)19-12/h3-7,9-10,16H,8H2,1-2H3,(H,23,24)(H2,19,20,22) |
| InChIKey | RQSUJBPFSUWQSA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (16568716) | Strain: SPF 32629 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 3.4.21.39 (chymase) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of chymase (EC 3.4.21.39). Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SPF-32629B (CHEBI:66518) has role Penicillium metabolite (CHEBI:76964) |
| SPF-32629B (CHEBI:66518) has role antimicrobial agent (CHEBI:33281) |
| SPF-32629B (CHEBI:66518) has role EC 3.4.21.39 (chymase) inhibitor (CHEBI:64957) |
| SPF-32629B (CHEBI:66518) is a carboxylic ester (CHEBI:33308) |
| SPF-32629B (CHEBI:66518) is a monocarboxylic acid (CHEBI:25384) |
| SPF-32629B (CHEBI:66518) is a monohydroxypyridine (CHEBI:38182) |
| SPF-32629B (CHEBI:66518) is a pyridone (CHEBI:38183) |
| IUPAC Name |
|---|
| 4-hydroxy-6-{[(3-methylbutanoyl)oxy](phenyl)methyl}-2-oxo-1,2-dihydropyridine-3-carboxylic acid |
| Citations |
|---|