EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H32O8 |
| Net Charge | 0 |
| Average Mass | 628.677 |
| Monoisotopic Mass | 628.20972 |
| SMILES | [H][C@]12[C@@]3(c4ccc(O)c5c4OC(C)(C)C=C5)Oc4cc(O)ccc4[C@]1([H])CC(C)=C[C@]2([H])c1c(O)cc(-c2cc4ccc(O)cc4o2)cc1O3 |
| InChI | InChI=1S/C39H32O8/c1-19-12-26-24-7-6-23(41)18-33(24)45-39(28-8-9-29(42)25-10-11-38(2,3)47-37(25)28)36(26)27(13-19)35-30(43)14-21(16-34(35)46-39)31-15-20-4-5-22(40)17-32(20)44-31/h4-11,13-18,26-27,36,40-43H,12H2,1-3H3/t26-,27+,36-,39-/m0/s1 |
| InChIKey | GOBAQYCCUYZMJY-HGLYATPPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sorocea muriculata (ncbitaxon:241923) | root (BTO:0001188) | PubMed (18847244) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sorocenol G (CHEBI:66514) has role antibacterial agent (CHEBI:33282) |
| sorocenol G (CHEBI:66514) has role metabolite (CHEBI:25212) |
| sorocenol G (CHEBI:66514) is a 1-benzofurans (CHEBI:38830) |
| sorocenol G (CHEBI:66514) is a chromenes (CHEBI:23232) |
| sorocenol G (CHEBI:66514) is a organic heteropentacyclic compound (CHEBI:38164) |
| sorocenol G (CHEBI:66514) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (3aS,8aR,13bR,13cS)-6-(6-hydroxy-1-benzofuran-2-yl)-8a-(5-hydroxy-2,2-dimethyl-2H-chromen-8-yl)-2-methyl-1,8a,13b,13c-tetrahydro-3aH-benzo[3,4]isochromeno[1,8-bc]chromene-4,11-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19203597 | Reaxys |
| Citations |
|---|