EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28O6 |
| Net Charge | 0 |
| Average Mass | 424.493 |
| Monoisotopic Mass | 424.18859 |
| SMILES | CC(C)=CCOc1cc(O)c2c(c1CC=C(C)C)OC(c1ccc(O)cc1O)CC2=O |
| InChI | InChI=1S/C25H28O6/c1-14(2)5-7-18-22(30-10-9-15(3)4)12-20(28)24-21(29)13-23(31-25(18)24)17-8-6-16(26)11-19(17)27/h5-6,8-9,11-12,23,26-28H,7,10,13H2,1-4H3 |
| InChIKey | SXRPAWKWQUYIOI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sophora flavescens (ncbitaxon:49840) | root (BTO:0001188) | PubMed (16933887) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sophoraflavanone L (CHEBI:66513) has role antineoplastic agent (CHEBI:35610) |
| sophoraflavanone L (CHEBI:66513) has role metabolite (CHEBI:25212) |
| sophoraflavanone L (CHEBI:66513) is a 4'-hydroxyflavanones (CHEBI:140331) |
| sophoraflavanone L (CHEBI:66513) is a trihydroxyflavanone (CHEBI:38739) |
| IUPAC Name |
|---|
| 2-(2,4-dihydroxyphenyl)-5-hydroxy-8-(3-methylbut-2-en-1-yl)-7-[(3-methylbut-2-en-1-yl)oxy]-2,3-dihydro-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| 5,2',4'-trihydroxy-7-(γ,γ-dimethylallyloxy)-8-(γ,γ-dimethylallyl)flavanone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15869809 | Reaxys |
| Citations |
|---|