EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O4 |
| Net Charge | 0 |
| Average Mass | 332.440 |
| Monoisotopic Mass | 332.19876 |
| SMILES | [H][C@]12C[C@]3([H])C(=C)C(=O)O[C@@]3([H])C/C(C)=C/CC/C(C)=C/CC[C@@]1(CO)O2 |
| InChI | InChI=1S/C20H28O4/c1-13-6-4-7-14(2)10-17-16(15(3)19(22)23-17)11-18-20(12-21,24-18)9-5-8-13/h7-8,16-18,21H,3-6,9-12H2,1-2H3/b13-8+,14-7+/t16-,17+,18+,20+/m1/s1 |
| InChIKey | PRUIDJLINDRLON-MKSAAGMNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sinularia gibberosa (WORMS:288527) | - | PubMed (15921403) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sinularolide D (CHEBI:66509) has role antineoplastic agent (CHEBI:35610) |
| sinularolide D (CHEBI:66509) has role metabolite (CHEBI:25212) |
| sinularolide D (CHEBI:66509) is a cembrane diterpenoid (CHEBI:60687) |
| sinularolide D (CHEBI:66509) is a epoxide (CHEBI:32955) |
| sinularolide D (CHEBI:66509) is a macrocycle (CHEBI:51026) |
| sinularolide D (CHEBI:66509) is a primary alcohol (CHEBI:15734) |
| sinularolide D (CHEBI:66509) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (1aS,4E,8E,10aS,13aR,14aS)-1a-(hydroxymethyl)-5,9-dimethyl-13-methylidene-2,3,6,7,10,10a,13,13a,14,14a-decahydrooxireno[4,5]cyclotetradeca[1,2-b]furan-12(1aH)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10720037 | Reaxys |
| Citations |
|---|