EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H42O6 |
| Net Charge | 0 |
| Average Mass | 486.649 |
| Monoisotopic Mass | 486.29814 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCC(=C)C(C)C(=O)O)[C@@]1(C)[C@@H](O)C(=O)C1=C2C(=O)C[C@@]2([H])[C@H](C)[C@H](O)CC[C@]12C |
| InChI | InChI=1S/C29H42O6/c1-14(16(3)27(34)35)7-8-15(2)18-9-10-19-23-22(31)13-20-17(4)21(30)11-12-28(20,5)24(23)25(32)26(33)29(18,19)6/h15-21,26,30,33H,1,7-13H2,2-6H3,(H,34,35)/t15-,16?,17+,18-,19+,20+,21-,26+,28+,29-/m1/s1 |
| InChIKey | LVFHKUZOQUATIE-NIQDNRFFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taiwanofungus camphoratus (ncbitaxon:196114) | |||
| fruit body (BTO:0000487) | PubMed (8594142) | ||
| fruit body (BTO:0000487) | PubMed (15095145) | ||
| fruit body (BTO:0000487) | PubMed (21028898) | Parasitic to the inner heartwood wall of old hollow trunks of Cinnamomum kanehirai, EtOH extract |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zhankuic acid C (CHEBI:66505) has role antineoplastic agent (CHEBI:35610) |
| zhankuic acid C (CHEBI:66505) has role metabolite (CHEBI:25212) |
| zhankuic acid C (CHEBI:66505) is a 11-oxo steroid (CHEBI:47787) |
| zhankuic acid C (CHEBI:66505) is a 12α-hydroxy steroid (CHEBI:36846) |
| zhankuic acid C (CHEBI:66505) is a 3α-hydroxy steroid (CHEBI:36835) |
| zhankuic acid C (CHEBI:66505) is a 7-oxo steroid (CHEBI:47789) |
| zhankuic acid C (CHEBI:66505) is a monocarboxylic acid (CHEBI:25384) |
| zhankuic acid C (CHEBI:66505) is a secondary α-hydroxy ketone (CHEBI:2468) |
| zhankuic acid C (CHEBI:66505) is a steroid acid (CHEBI:47891) |
| IUPAC Name |
|---|
| (3α,4α,5α,12α)-3,12-dihydroxy-4-methyl-7,11-dioxoergosta-8,24(28)-dien-26-oic acid |
| Synonym | Source |
|---|---|
| 3α,12α-dihydroxy-4α-methylergosta-8,24(28)-dien-7,11-dione-26-oic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9827877 | Reaxys |
| Citations |
|---|