EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H42O5 |
| Net Charge | 0 |
| Average Mass | 470.650 |
| Monoisotopic Mass | 470.30322 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCC(=C)C(C)C(=O)O)[C@@]1(C)CC(=O)C1=C2C(=O)C[C@@]2([H])[C@H](C)[C@H](O)CC[C@]12C |
| InChI | InChI=1S/C29H42O5/c1-15(17(3)27(33)34)7-8-16(2)19-9-10-20-25-23(31)13-21-18(4)22(30)11-12-28(21,5)26(25)24(32)14-29(19,20)6/h16-22,30H,1,7-14H2,2-6H3,(H,33,34)/t16-,17?,18+,19-,20+,21+,22-,28+,29-/m1/s1 |
| InChIKey | TXEJUZMIQVTZHO-JNXQNPAGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taiwanofungus camphoratus (ncbitaxon:196114) | |||
| fruit body (BTO:0000487) | PubMed (8594142) | ||
| fruit body (BTO:0000487) | PubMed (15095145) | ||
| fruit body (BTO:0000487) | PubMed (21028898) | Parasitic to the inner heartwood wall of old hollow trunks of Cinnamomum kanehirai, EtOH extract |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zhankuic acid B (CHEBI:66504) has role antineoplastic agent (CHEBI:35610) |
| zhankuic acid B (CHEBI:66504) has role cholinergic antagonist (CHEBI:48873) |
| zhankuic acid B (CHEBI:66504) has role metabolite (CHEBI:25212) |
| zhankuic acid B (CHEBI:66504) has role serotonergic antagonist (CHEBI:48279) |
| zhankuic acid B (CHEBI:66504) is a 11-oxo steroid (CHEBI:47787) |
| zhankuic acid B (CHEBI:66504) is a 3α-hydroxy steroid (CHEBI:36835) |
| zhankuic acid B (CHEBI:66504) is a 7-oxo steroid (CHEBI:47789) |
| zhankuic acid B (CHEBI:66504) is a monocarboxylic acid (CHEBI:25384) |
| zhankuic acid B (CHEBI:66504) is a steroid acid (CHEBI:47891) |
| IUPAC Name |
|---|
| (3α,4α,5α)-3-hydroxy-4-methyl-7,11-dioxoergosta-8,24(28)-dien-26-oic acid |
| Synonym | Source |
|---|---|
| 3α-hydroxy-4alpha-methylergosta-8,24(28)-dien-7,11-dione-26-oic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9825705 | Reaxys |
| Citations |
|---|