EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20O4 |
| Net Charge | 0 |
| Average Mass | 288.343 |
| Monoisotopic Mass | 288.13616 |
| SMILES | [H][C@@]12C[C@H](OC(C)=O)C(=C)[C@]1([H])[C@H]1OC(=O)C(=C)[C@@H]1CCC2=C |
| InChI | InChI=1S/C17H20O4/c1-8-5-6-12-9(2)17(19)21-16(12)15-10(3)14(7-13(8)15)20-11(4)18/h12-16H,1-3,5-7H2,4H3/t12-,13-,14-,15-,16-/m0/s1 |
| InChIKey | GKMFOEIZCLMZDE-QXKUPLGCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Laurus nobilis (ncbitaxon:85223) | leaf (BTO:0000713) | PubMed (12419922) | |
| Zaluzania triloba (ncbitaxon:505286) | - | DOI (10.1016/S0040-4020(01)97900-1) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| Application: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zaluzanin D (CHEBI:66500) has role metabolite (CHEBI:25212) |
| zaluzanin D (CHEBI:66500) has role trypanocidal drug (CHEBI:36335) |
| zaluzanin D (CHEBI:66500) is a acetate ester (CHEBI:47622) |
| zaluzanin D (CHEBI:66500) is a guaiane sesquiterpenoid (CHEBI:36744) |
| zaluzanin D (CHEBI:66500) is a organic heterotricyclic compound (CHEBI:26979) |
| zaluzanin D (CHEBI:66500) is a sesquiterpene lactone (CHEBI:37667) |
| zaluzanin D (CHEBI:66500) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aS,6aR,8S,9aR,9bS)-3,6,9-trimethylidene-2-oxododecahydroazuleno[4,5-b]furan-8-yl acetate |
| Synonyms | Source |
|---|---|
| (3aS,6aR,8S,9aR,9bS)-8-(acetyloxy)decahydro-3,6,9-tris(methylene)azuleno(4,5-b)furan-2(3H)-one | ChemIDplus |
| 3β-acetoxy-guaia-4(15),10(14),11(13)-trien-12,6α-olide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4523574 | Reaxys |
| CAS:16838-85-0 | ChemIDplus |
| Citations |
|---|