EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H33NO4 |
| Net Charge | 0 |
| Average Mass | 399.531 |
| Monoisotopic Mass | 399.24096 |
| SMILES | CCC[C@@H](C)[C@H](OC(=O)/C=C/c1ccccc1)[C@H](C)[C@H](O)C/C=C/C=C\C(N)=O |
| InChI | InChI=1S/C24H33NO4/c1-4-11-18(2)24(19(3)21(26)14-9-6-10-15-22(25)27)29-23(28)17-16-20-12-7-5-8-13-20/h5-10,12-13,15-19,21,24,26H,4,11,14H2,1-3H3,(H2,25,27)/b9-6+,15-10-,17-16+/t18-,19-,21-,24+/m1/s1 |
| InChIKey | OJAGQZQYWOJBHT-PKJHRQCFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus sp. (ncbitaxon:1409) | - | PubMed (8641995) | Strain: YL 03709B |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| YM-47522 (CHEBI:66496) has role antifungal agent (CHEBI:35718) |
| YM-47522 (CHEBI:66496) has role antimicrobial agent (CHEBI:33281) |
| YM-47522 (CHEBI:66496) has role metabolite (CHEBI:25212) |
| YM-47522 (CHEBI:66496) is a cinnamate ester (CHEBI:36087) |
| YM-47522 (CHEBI:66496) is a enamide (CHEBI:51751) |
| YM-47522 (CHEBI:66496) is a primary carboxamide (CHEBI:140324) |
| YM-47522 (CHEBI:66496) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (4R,5S,6R,7R,9E,11Z)-13-amino-7-hydroxy-4,6-dimethyl-13-oxotrideca-9,11-dien-5-yl (2E)-3-phenylprop-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7626798 | Reaxys |
| Citations |
|---|