EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H64N8O13 |
| Net Charge | 0 |
| Average Mass | 901.028 |
| Monoisotopic Mass | 900.45928 |
| SMILES | [H][C@@]1(NC(=O)[C@@H](NC(=O)[C@H](Cc2ccccc2)NC(=O)CC(C)C)[C@@H](C)O)C(=O)N[C@@H](CC(C)C)C(=O)C(=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C)C(=O)O[C@@H]1C |
| InChI | InChI=1S/C43H64N8O13/c1-20(2)15-27-35(55)36(56)42(62)49-28(16-21(3)4)38(58)48-30(19-31(44)53)37(57)45-23(7)43(63)64-25(9)34(41(61)47-27)51-40(60)33(24(8)52)50-39(59)29(46-32(54)17-22(5)6)18-26-13-11-10-12-14-26/h10-14,20-25,27-30,33-34,52H,15-19H2,1-9H3,(H2,44,53)(H,45,57)(H,46,54)(H,47,61)(H,48,58)(H,49,62)(H,50,59)(H,51,60)/t23-,24-,25-,27+,28+,29+,30+,33+,34+/m1/s1 |
| InChIKey | WDOYVAJHZHVZQI-KNFAUAPHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Flexibacter (ncbitaxon:1005) | - | PubMed (8557598) | Strain: Q17897 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. EC 3.4.21.37 (leukocyte elastase) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the activity of leukocyte elastase (EC 3.4.21.37). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| YM-47142 (CHEBI:66495) has role antimicrobial agent (CHEBI:33281) |
| YM-47142 (CHEBI:66495) has role EC 3.4.21.37 (leukocyte elastase) inhibitor (CHEBI:64922) |
| YM-47142 (CHEBI:66495) has role metabolite (CHEBI:25212) |
| YM-47142 (CHEBI:66495) is a cyclodepsipeptide (CHEBI:35213) |
| YM-47142 (CHEBI:66495) is a macrocycle (CHEBI:51026) |
| IUPAC Name |
|---|
| N-(3-methylbutanoyl)-L-phenylalanyl-N-[(3R,6S,9S,14S,17S,18R)-6-(2-amino-2-oxoethyl)-3,18-dimethyl-9,14-bis(2-methylpropyl)-2,5,8,11,12,13,16-heptaoxo-1-oxa-4,7,10,15-tetraazacyclooctadecan-17-yl]-L-threoninamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7461361 | Reaxys |
| Citations |
|---|