EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H64N8O13 |
| Net Charge | 0 |
| Average Mass | 901.028 |
| Monoisotopic Mass | 900.45928 |
| SMILES | [H][C@@]1(NC(=O)[C@@H](NC(=O)[C@H](Cc2ccccc2)NC(=O)CC(C)C)[C@@H](C)O)C(=O)N[C@@H](CC(C)C)C(=O)C(=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C)C(=O)O[C@@H]1C |
| InChI | InChI=1S/C43H64N8O13/c1-20(2)15-27-35(55)36(56)42(62)49-28(16-21(3)4)38(58)48-30(19-31(44)53)37(57)45-23(7)43(63)64-25(9)34(41(61)47-27)51-40(60)33(24(8)52)50-39(59)29(46-32(54)17-22(5)6)18-26-13-11-10-12-14-26/h10-14,20-25,27-30,33-34,52H,15-19H2,1-9H3,(H2,44,53)(H,45,57)(H,46,54)(H,47,61)(H,48,58)(H,49,62)(H,50,59)(H,51,60)/t23-,24-,25-,27+,28+,29+,30+,33+,34+/m1/s1 |
| InChIKey | WDOYVAJHZHVZQI-KNFAUAPHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Flexibacter (ncbitaxon:1005) | - | PubMed (8557598) | Strain: Q17897 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.4.21.37 (leukocyte elastase) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the activity of leukocyte elastase (EC 3.4.21.37). antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| YM-47142 (CHEBI:66495) has role antimicrobial agent (CHEBI:33281) |
| YM-47142 (CHEBI:66495) has role EC 3.4.21.37 (leukocyte elastase) inhibitor (CHEBI:64922) |
| YM-47142 (CHEBI:66495) has role metabolite (CHEBI:25212) |
| YM-47142 (CHEBI:66495) is a cyclodepsipeptide (CHEBI:35213) |
| YM-47142 (CHEBI:66495) is a macrocycle (CHEBI:51026) |
| IUPAC Name |
|---|
| N-(3-methylbutanoyl)-L-phenylalanyl-N-[(3R,6S,9S,14S,17S,18R)-6-(2-amino-2-oxoethyl)-3,18-dimethyl-9,14-bis(2-methylpropyl)-2,5,8,11,12,13,16-heptaoxo-1-oxa-4,7,10,15-tetraazacyclooctadecan-17-yl]-L-threoninamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7461361 | Reaxys |
| Citations |
|---|