EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H24O6 |
| Net Charge | 0 |
| Average Mass | 420.461 |
| Monoisotopic Mass | 420.15729 |
| SMILES | C=C(C)C(O)Cc1cc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc2c1OC(C)(C)C=C2 |
| InChI | InChI=1S/C25H24O6/c1-13(2)18(27)9-16-8-15(7-14-5-6-25(3,4)31-24(14)16)21-12-20(29)23-19(28)10-17(26)11-22(23)30-21/h5-8,10-12,18,26-28H,1,9H2,2-4H3 |
| InChIKey | ZAUWPDSVLSOCDG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Epimedium sagittatum (ncbitaxon:253616) | leaf (BTO:0000713) | PubMed (8699184) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| yinyanghuo A (CHEBI:66492) has role metabolite (CHEBI:25212) |
| yinyanghuo A (CHEBI:66492) has role platelet aggregation inhibitor (CHEBI:50427) |
| yinyanghuo A (CHEBI:66492) is a dihydroxyflavone (CHEBI:38686) |
| yinyanghuo A (CHEBI:66492) is a extended flavonoid (CHEBI:71037) |
| yinyanghuo A (CHEBI:66492) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-8'-(2-hydroxy-3-methylbut-3-en-1-yl)-2',2'-dimethyl-2'H,4H-2,6'-bichromen-4-one |
| Manual Xrefs | Databases |
|---|---|
| LMPK12110428 | LIPID MAPS |
| Citations |
|---|