EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O8 |
| Net Charge | 0 |
| Average Mass | 414.410 |
| Monoisotopic Mass | 414.13147 |
| SMILES | COc1cc(OC)c2c(=O)c3c(O)c(OC)c4c(c3oc2c1OC)C=CC(C)(C)O4 |
| InChI | InChI=1S/C22H22O8/c1-22(2)8-7-10-17-14(16(24)21(28-6)18(10)30-22)15(23)13-11(25-3)9-12(26-4)19(27-5)20(13)29-17/h7-9,24H,1-6H3 |
| InChIKey | BSWKVMNQZNMVIO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcinia rigida (ncbitaxon:469938) | leaf (BTO:0000713) | PubMed (18313861) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| yahyaxanthone (CHEBI:66491) has role antineoplastic agent (CHEBI:35610) |
| yahyaxanthone (CHEBI:66491) has role metabolite (CHEBI:25212) |
| yahyaxanthone (CHEBI:66491) is a aromatic ether (CHEBI:35618) |
| yahyaxanthone (CHEBI:66491) is a phenols (CHEBI:33853) |
| yahyaxanthone (CHEBI:66491) is a pyranoxanthones (CHEBI:71238) |
| IUPAC Name |
|---|
| 6-hydroxy-5,8,10,11-tetramethoxy-3,3-dimethyl-3H,7H-pyrano[2,3-c]xanthen-7-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15808504 | Reaxys |
| Citations |
|---|