EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H34N2O8 |
| Net Charge | 0 |
| Average Mass | 574.630 |
| Monoisotopic Mass | 574.23152 |
| SMILES | [H][C@]12CCC=C(C)[C@]1(C)[C@@H](OC(=O)c1cccnc1)[C@H](OC(=O)c1cccnc1)[C@](C)(O)[C@]2(C)[C@@]1([H])CC2=C(O1)C(=O)OC2 |
| InChI | InChI=1S/C32H34N2O8/c1-18-8-5-11-22-30(18,2)25(41-27(35)19-9-6-12-33-15-19)26(42-28(36)20-10-7-13-34-16-20)32(4,38)31(22,3)23-14-21-17-39-29(37)24(21)40-23/h6-10,12-13,15-16,22-23,25-26,38H,5,11,14,17H2,1-4H3/t22-,23+,25-,26-,30-,31-,32-/m0/s1 |
| InChIKey | SWHUWIGLVRXJBW-IVZGSMFXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scutellaria barbata (ncbitaxon:396367) | aerial part (BTO:0001658) | PubMed (17666848) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-O-Nicotinoyl scutebarbatine H, (rel) (CHEBI:66490) has role metabolite (CHEBI:25212) |
| 7-O-Nicotinoyl scutebarbatine H, (rel) (CHEBI:66490) is a diterpene lactone (CHEBI:49193) |
| Citations |
|---|