EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H38N2O9 |
| Net Charge | 0 |
| Average Mass | 618.683 |
| Monoisotopic Mass | 618.25773 |
| SMILES | [H][C@]12CCC=C(C)[C@]1(C)[C@@H](OC(=O)c1cccnc1)[C@H](OC(C)=O)[C@]1(C)O[C@@]3(COC(=O)C3)C[C@H](OC(=O)c3cccnc3)[C@]21C |
| InChI | InChI=1S/C34H38N2O9/c1-20-9-6-12-24-31(20,3)27(44-30(40)23-11-8-14-36-18-23)28(42-21(2)37)33(5)32(24,4)25(15-34(45-33)16-26(38)41-19-34)43-29(39)22-10-7-13-35-17-22/h7-11,13-14,17-18,24-25,27-28H,6,12,15-16,19H2,1-5H3/t24-,25-,27-,28-,31-,32-,33-,34-/m0/s1 |
| InChIKey | MCZQKBCMIDJMDT-RJGRQJGLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scutellaria barbata (ncbitaxon:396367) | aerial part (BTO:0001658) | PubMed (17666848) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-O-Nicotinoyl-7-O-acetylscutebarbatine G, (rel) (CHEBI:66489) has role metabolite (CHEBI:25212) |
| 6-O-Nicotinoyl-7-O-acetylscutebarbatine G, (rel) (CHEBI:66489) is a organic heterotricyclic compound (CHEBI:26979) |
| 6-O-Nicotinoyl-7-O-acetylscutebarbatine G, (rel) (CHEBI:66489) is a organooxygen compound (CHEBI:36963) |
| Citations |
|---|