EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:66486 - simalikalactone D
| Formula | C25H34O9 |
| Net Charge | 0 |
| Average Mass | 478.538 |
| Monoisotopic Mass | 478.22028 |
| SMILES | [H][C@]12[C@@H](O)[C@H](O)[C@]3(C)OC[C@]14[C@@]3([H])[C@@H](OC(=O)[C@H](C)CC)C(=O)O[C@]4([H])C[C@@]1([H])C(C)=CC(=O)[C@@H](O)[C@]21C |
| InChI | InChI=1S/C25H34O9/c1-6-10(2)21(30)34-16-18-24(5)20(29)15(27)17-23(4)12(11(3)7-13(26)19(23)28)8-14(33-22(16)31)25(17,18)9-32-24/h7,10,12,14-20,27-29H,6,8-9H2,1-5H3/t10-,12+,14-,15-,16-,17-,18+,19-,20+,23+,24-,25-/m1/s1 |
| InChIKey | OKIKYYZNNZCZRX-ZPUVFWQWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Quassia amara (ncbitaxon:43725) | leaf (BTO:0000713) | PubMed (16730421) | |
| Quassia africana (ncbitaxon:459167) | root (BTO:0001188) | PubMed (11842321) | Previous component: root bark; |
| Leitneria floridana (ncbitaxon:83908) | aerial part (BTO:0001658) | PubMed (11141127) | |
| Simaba guianensis (ncbitaxon:459152) | bark (BTO:0001301) | PubMed (8289064) | |
| Simaba multiflora (IPNI:236532-2) | - | PubMed (17340534) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| simalikalactone D (CHEBI:66486) has role antimalarial (CHEBI:38068) |
| simalikalactone D (CHEBI:66486) has role antineoplastic agent (CHEBI:35610) |
| simalikalactone D (CHEBI:66486) has role antiviral agent (CHEBI:22587) |
| simalikalactone D (CHEBI:66486) has role metabolite (CHEBI:25212) |
| simalikalactone D (CHEBI:66486) is a cyclic ether (CHEBI:37407) |
| simalikalactone D (CHEBI:66486) is a enone (CHEBI:51689) |
| simalikalactone D (CHEBI:66486) is a organic heteropentacyclic compound (CHEBI:38164) |
| simalikalactone D (CHEBI:66486) is a quassinoid (CHEBI:72485) |
| simalikalactone D (CHEBI:66486) is a secondary alcohol (CHEBI:35681) |
| simalikalactone D (CHEBI:66486) is a secondary α-hydroxy ketone (CHEBI:2468) |
| simalikalactone D (CHEBI:66486) is a triol (CHEBI:27136) |
| simalikalactone D (CHEBI:66486) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (1β,11β,12α,15βb)-1,11,12-trihydroxy-2,16-dioxo-13,20-epoxypicras-3-en-15-yl (2R)-2-methylbutanoate |
| Synonym | Source |
|---|---|
| (+)-simalikalactone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5386394 | Reaxys |
| CAS:35321-80-3 | ChemIDplus |
| CAS:35321-80-3 | KEGG COMPOUND |
| Citations |
|---|