EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:66486 - simalikalactone D
| Formula | C25H34O9 |
| Net Charge | 0 |
| Average Mass | 478.538 |
| Monoisotopic Mass | 478.22028 |
| SMILES | [H][C@]12[C@@H](O)[C@H](O)[C@]3(C)OC[C@]14[C@@]3([H])[C@@H](OC(=O)[C@H](C)CC)C(=O)O[C@]4([H])C[C@@]1([H])C(C)=CC(=O)[C@@H](O)[C@]21C |
| InChI | InChI=1S/C25H34O9/c1-6-10(2)21(30)34-16-18-24(5)20(29)15(27)17-23(4)12(11(3)7-13(26)19(23)28)8-14(33-22(16)31)25(17,18)9-32-24/h7,10,12,14-20,27-29H,6,8-9H2,1-5H3/t10-,12+,14-,15-,16-,17-,18+,19-,20+,23+,24-,25-/m1/s1 |
| InChIKey | OKIKYYZNNZCZRX-ZPUVFWQWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Leitneria floridana (ncbitaxon:83908) | aerial part (BTO:0001658) | PubMed (11141127) | |
| Quassia africana (ncbitaxon:459167) | root (BTO:0001188) | PubMed (11842321) | Previous component: root bark; |
| Quassia amara (ncbitaxon:43725) | leaf (BTO:0000713) | PubMed (16730421) | |
| Simaba guianensis (ncbitaxon:459152) | bark (BTO:0001301) | PubMed (8289064) | |
| Simaba multiflora (IPNI:236532-2) | - | PubMed (17340534) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antiviral agent A substance that destroys or inhibits replication of viruses. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| simalikalactone D (CHEBI:66486) has role antimalarial (CHEBI:38068) |
| simalikalactone D (CHEBI:66486) has role antineoplastic agent (CHEBI:35610) |
| simalikalactone D (CHEBI:66486) has role antiviral agent (CHEBI:22587) |
| simalikalactone D (CHEBI:66486) has role metabolite (CHEBI:25212) |
| simalikalactone D (CHEBI:66486) is a cyclic ether (CHEBI:37407) |
| simalikalactone D (CHEBI:66486) is a enone (CHEBI:51689) |
| simalikalactone D (CHEBI:66486) is a organic heteropentacyclic compound (CHEBI:38164) |
| simalikalactone D (CHEBI:66486) is a quassinoid (CHEBI:72485) |
| simalikalactone D (CHEBI:66486) is a secondary alcohol (CHEBI:35681) |
| simalikalactone D (CHEBI:66486) is a secondary α-hydroxy ketone (CHEBI:2468) |
| simalikalactone D (CHEBI:66486) is a triol (CHEBI:27136) |
| simalikalactone D (CHEBI:66486) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (1β,11β,12α,15βb)-1,11,12-trihydroxy-2,16-dioxo-13,20-epoxypicras-3-en-15-yl (2R)-2-methylbutanoate |
| Synonym | Source |
|---|---|
| (+)-simalikalactone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5386394 | Reaxys |
| CAS:35321-80-3 | ChemIDplus |
| CAS:35321-80-3 | KEGG COMPOUND |
| Citations |
|---|