EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H38O13 |
| Net Charge | 0 |
| Average Mass | 654.665 |
| Monoisotopic Mass | 654.23124 |
| SMILES | [H][C@]1([C@@H](O)CO)CO[C@@H](OC)[C@H](Oc2cc(OC)c3c(c2)O[C@@]2(c4ccc(OC)cc4)[C@H](c4ccccc4)[C@@H](C(=O)OC)[C@@H](O)[C@@]32O)O1 |
| InChI | InChI=1S/C34H38O13/c1-40-20-12-10-19(11-13-20)34-27(18-8-6-5-7-9-18)26(30(38)42-3)29(37)33(34,39)28-23(41-2)14-21(15-24(28)47-34)45-32-31(43-4)44-17-25(46-32)22(36)16-35/h5-15,22,25-27,29,31-32,35-37,39H,16-17H2,1-4H3/t22-,25+,26+,27+,29+,31+,32+,33-,34-/m0/s1 |
| InChIKey | GVKXFVCXBFGBCD-JRPGFILLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aglaia silvestris (ncbitaxon:306516) | |||
| fruit (BTO:0000486) | PubMed (15132542) | ||
| twig (BTO:0001411) | PubMed (15132542) | ||
| Aglaia foveolata (IPNI:968391-1) | stem (BTO:0001300) | PubMed (20939540) | Previous component: stem bark; Methanolic extract of dried stem bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epi-silvestrol (CHEBI:66485) has role antineoplastic agent (CHEBI:35610) |
| epi-silvestrol (CHEBI:66485) has role metabolite (CHEBI:25212) |
| epi-silvestrol (CHEBI:66485) is a dioxanes (CHEBI:46926) |
| epi-silvestrol (CHEBI:66485) is a ether (CHEBI:25698) |
| epi-silvestrol (CHEBI:66485) is a methyl ester (CHEBI:25248) |
| epi-silvestrol (CHEBI:66485) is a organic heterotricyclic compound (CHEBI:26979) |
| IUPAC Name |
|---|
| methyl (1R,2R,3S,3aR,8bS)-6-({(2S,3R,6R)-6-[(1S)-1,2-dihydroxyethyl]-3-methoxy-1,4-dioxan-2-yl}oxy)-1,8b-dihydroxy-8-methoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3,3a,8b-tetrahydro-1H-benzo[b]cyclopenta[d]furan-2-carboxylate |
| Synonym | Source |
|---|---|
| 5'''-episilvestrol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9977231 | Reaxys |
| Citations |
|---|