EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O6 |
| Net Charge | 0 |
| Average Mass | 356.374 |
| Monoisotopic Mass | 356.12599 |
| SMILES | CC(C)=CCc1cc([C@@H]2CC(=O)c3c(O)cc(O)cc3O2)cc(O)c1O |
| InChI | InChI=1S/C20H20O6/c1-10(2)3-4-11-5-12(6-16(24)20(11)25)17-9-15(23)19-14(22)7-13(21)8-18(19)26-17/h3,5-8,17,21-22,24-25H,4,9H2,1-2H3/t17-/m0/s1 |
| InChIKey | SFQIGPZCFNTPOD-KRWDZBQOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Erythrina sigmoidea (IPNI:494581-1) | bark (BTO:0001301) | PubMed (14994185) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sigmoidin B (CHEBI:66483) has functional parent (2S)-flavanone (CHEBI:15606) |
| sigmoidin B (CHEBI:66483) has role anti-inflammatory agent (CHEBI:67079) |
| sigmoidin B (CHEBI:66483) has role antibacterial agent (CHEBI:33282) |
| sigmoidin B (CHEBI:66483) has role metabolite (CHEBI:25212) |
| sigmoidin B (CHEBI:66483) has role radical scavenger (CHEBI:48578) |
| sigmoidin B (CHEBI:66483) is a 4'-hydroxyflavanones (CHEBI:140331) |
| sigmoidin B (CHEBI:66483) is a tetrahydroxyflavanone (CHEBI:38742) |
| Synonyms | Source |
|---|---|
| (2S)- 2-(3,4-dihydroxy-5-(3-methyl-2-butenyl)phenyl)-2,3-dihydro-5,7-dihydroxy-4H-1-benzopyran-4-one | ChEBI |
| (2S)-2-[3,4-dihydroxy-5-(3-methylbut-2-en-1-yl)phenyl]-5,7-dihydroxy-2,3-dihydro-4H-chromen-4-one | ChEBI |
| 5,7,3',4'-tetrahydroxy-5'-prenylflavone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPK12140397 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5137677 | Reaxys |
| CAS:87746-47-2 | ChemIDplus |
| Citations |
|---|