EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28O6 |
| Net Charge | 0 |
| Average Mass | 424.493 |
| Monoisotopic Mass | 424.18859 |
| SMILES | CC(C)=CCc1cc([C@@H]2CC(=O)c3c(O)cc(O)cc3O2)c(CC=C(C)C)c(O)c1O |
| InChI | InChI=1S/C25H28O6/c1-13(2)5-7-15-9-18(17(8-6-14(3)4)25(30)24(15)29)21-12-20(28)23-19(27)10-16(26)11-22(23)31-21/h5-6,9-11,21,26-27,29-30H,7-8,12H2,1-4H3/t21-/m0/s1 |
| InChIKey | BVHLNRAYBCPKOY-NRFANRHFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Erythrina sigmoidea (IPNI:494581-1) | bark (BTO:0001301) | PubMed (14994185) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. anti-obesity agent Any substance which is used to reduce or control weight. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sigmoidin A (CHEBI:66482) has functional parent (2S)-flavanone (CHEBI:15606) |
| sigmoidin A (CHEBI:66482) has role anti-inflammatory agent (CHEBI:67079) |
| sigmoidin A (CHEBI:66482) has role anti-obesity agent (CHEBI:74518) |
| sigmoidin A (CHEBI:66482) has role antibacterial agent (CHEBI:33282) |
| sigmoidin A (CHEBI:66482) has role metabolite (CHEBI:25212) |
| sigmoidin A (CHEBI:66482) has role radical scavenger (CHEBI:48578) |
| sigmoidin A (CHEBI:66482) is a 4'-hydroxyflavanones (CHEBI:140331) |
| sigmoidin A (CHEBI:66482) is a tetrahydroxyflavanone (CHEBI:38742) |
| IUPAC Name |
|---|
| (2S)-2-[3,4-dihydroxy-2,5-bis(3-methylbut-2-en-1-yl)phenyl]-5,7-dihydroxy-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| (2S)- 2-(3,4-dihydroxy-2,5-bis(3-methyl-2-butenyl)phenyl)-2,3-dihydro-5,7-dihydroxy-4H-1-benzopyran-4-one | ChEBI |
| 5,7,3',4'-tetrahydroxy-2',5'-diprenylflavone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPK12140398 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5171104 | Reaxys |
| CAS:87746-48-3 | ChemIDplus |
| Citations |
|---|