EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H23NO4 |
| Net Charge | 0 |
| Average Mass | 293.363 |
| Monoisotopic Mass | 293.16271 |
| SMILES | [H][C@@]12CC(=O)[C@@]34CC[C@@]([H])(O3)N(O)CCC[C@@]14C(=O)C[C@@H](C)C2 |
| InChI | InChI=1S/C16H23NO4/c1-10-7-11-9-13(19)16-5-3-14(21-16)17(20)6-2-4-15(11,16)12(18)8-10/h10-11,14,20H,2-9H2,1H3/t10-,11+,14+,15-,16+/m0/s1 |
| InChIKey | PKOSXQDNEYPWGG-KCGURWGYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lycopodium sieboldii (IPNI:17518300-1) | - | PubMed (14535761) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sieboldine A(rel) (CHEBI:66481) has role metabolite (CHEBI:25212) |
| Sieboldine A(rel) (CHEBI:66481) is a furans (CHEBI:24129) |
| Sieboldine A(rel) (CHEBI:66481) is a organonitrogen compound (CHEBI:35352) |
| Manual Xrefs | Databases |
|---|---|
| 9997134 | ChemSpider |
| Citations |
|---|