EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24O8 |
| Net Charge | 0 |
| Average Mass | 344.360 |
| Monoisotopic Mass | 344.14712 |
| SMILES | CC(C)=C[C@H]1C/C(=C/CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(=O)O1 |
| InChI | InChI=1S/C16H24O8/c1-8(2)5-10-6-9(15(21)23-10)3-4-22-16-14(20)13(19)12(18)11(7-17)24-16/h3,5,10-14,16-20H,4,6-7H2,1-2H3/b9-3-/t10-,11+,12+,13-,14+,16+/m0/s1 |
| InChIKey | AYOGZIXAHOAPOK-QKAQTOFFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sibiraea angustata (ncbitaxon:1055022) | aerial part (BTO:0001658) | PubMed (19252323) |
| Roles Classification |
|---|
| Biological Roles: | anti-obesity agent Any substance which is used to reduce or control weight. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sibiskoside (CHEBI:66480) has role anti-obesity agent (CHEBI:74518) |
| sibiskoside (CHEBI:66480) has role metabolite (CHEBI:25212) |
| sibiskoside (CHEBI:66480) is a monosaccharide derivative (CHEBI:63367) |
| sibiskoside (CHEBI:66480) is a monoterpene glycoside (CHEBI:72293) |
| sibiskoside (CHEBI:66480) is a terpene lactone (CHEBI:37668) |
| sibiskoside (CHEBI:66480) is a β-D-glucoside (CHEBI:22798) |
| sibiskoside (CHEBI:66480) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (2Z)-2-[(5R)-5-(2-methylprop-1-en-1-yl)-2-oxodihydrofuran-3(2H)-ylidene]ethyl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 1-O-β-D-glucopyranosyl-geraniol-5,10-olide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19888886 | Reaxys |
| Citations |
|---|