EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24O8 |
| Net Charge | 0 |
| Average Mass | 344.360 |
| Monoisotopic Mass | 344.14712 |
| SMILES | CC(C)=C[C@H]1C/C(=C/CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(=O)O1 |
| InChI | InChI=1S/C16H24O8/c1-8(2)5-10-6-9(15(21)23-10)3-4-22-16-14(20)13(19)12(18)11(7-17)24-16/h3,5,10-14,16-20H,4,6-7H2,1-2H3/b9-3-/t10-,11+,12+,13-,14+,16+/m0/s1 |
| InChIKey | AYOGZIXAHOAPOK-QKAQTOFFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sibiraea angustata (ncbitaxon:1055022) | aerial part (BTO:0001658) | PubMed (19252323) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-obesity agent Any substance which is used to reduce or control weight. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sibiskoside (CHEBI:66480) has role anti-obesity agent (CHEBI:74518) |
| sibiskoside (CHEBI:66480) has role metabolite (CHEBI:25212) |
| sibiskoside (CHEBI:66480) is a monosaccharide derivative (CHEBI:63367) |
| sibiskoside (CHEBI:66480) is a monoterpene glycoside (CHEBI:72293) |
| sibiskoside (CHEBI:66480) is a terpene lactone (CHEBI:37668) |
| sibiskoside (CHEBI:66480) is a β-D-glucoside (CHEBI:22798) |
| sibiskoside (CHEBI:66480) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (2Z)-2-[(5R)-5-(2-methylprop-1-en-1-yl)-2-oxodihydrofuran-3(2H)-ylidene]ethyl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 1-O-β-D-glucopyranosyl-geraniol-5,10-olide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19888886 | Reaxys |
| Citations |
|---|