EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34N2O9 |
| Net Charge | 0 |
| Average Mass | 494.541 |
| Monoisotopic Mass | 494.22643 |
| SMILES | [H][C@@]1([C@H](O)[C@H](O)C(=O)N[C@@H](CC(C)C)[C@]2([H])Cc3cccc(O)c3C(=O)O2)CC(=O)OC(C)(O)[C@H](C)N1 |
| InChI | InChI=1S/C24H34N2O9/c1-11(2)8-14(17-9-13-6-5-7-16(27)19(13)23(32)34-17)26-22(31)21(30)20(29)15-10-18(28)35-24(4,33)12(3)25-15/h5-7,11-12,14-15,17,20-21,25,27,29-30,33H,8-10H2,1-4H3,(H,26,31)/t12-,14-,15-,17-,20-,21-,24?/m0/s1 |
| InChIKey | VWEGLEKHUIRPCH-BGAXJHJKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternaria tenuis (ncbitaxon:509205) | - | PubMed (16915820) | Strain: SG 17-1 |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sg17-1-4 (CHEBI:66478) has role antineoplastic agent (CHEBI:35610) |
| Sg17-1-4 (CHEBI:66478) has role fungal metabolite (CHEBI:76946) |
| Sg17-1-4 (CHEBI:66478) has role marine metabolite (CHEBI:76507) |
| Sg17-1-4 (CHEBI:66478) is a isocoumarins (CHEBI:38758) |
| Sg17-1-4 (CHEBI:66478) is a monocarboxylic acid amide (CHEBI:29347) |
| Sg17-1-4 (CHEBI:66478) is a secondary alcohol (CHEBI:35681) |
| Sg17-1-4 (CHEBI:66478) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (2S,3S)-2,3-dihydroxy-3-[(3S,5S)-2-hydroxy-2,3-dimethyl-7-oxo-1,4-oxazepan-5-yl]-N-{(1S)-1-[(3S)-8-hydroxy-1-oxo-3,4-dihydro-1H-isochromen-3-yl]-3-methylbutyl}propanamide |
| Manual Xrefs | Databases |
|---|---|
| CN101029047 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10741764 | Reaxys |
| Citations |
|---|