EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H38O4 |
| Net Charge | 0 |
| Average Mass | 402.575 |
| Monoisotopic Mass | 402.27701 |
| SMILES | [H][C@]12C[C@@H](O)[C@]3(C)C4=C(CC[C@@]3([H])[C@]1(C)CC[C@@]1([H])[C@@](C)(CO)CCC[C@]21C)COC4=O |
| InChI | InChI=1S/C25H38O4/c1-22(14-26)9-5-10-23(2)16(22)8-11-24(3)17-7-6-15-13-29-21(28)20(15)25(17,4)19(27)12-18(23)24/h16-19,26-27H,5-14H2,1-4H3/t16-,17-,18+,19+,22+,23-,24-,25+/m0/s1 |
| InChIKey | BHUWRPVVYSATJU-QDNKKCNYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hyrtios erectus (ncbitaxon:279628) | - | PubMed (9461648) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sesterstatin 2 (CHEBI:66476) has role antineoplastic agent (CHEBI:35610) |
| sesterstatin 2 (CHEBI:66476) has role metabolite (CHEBI:25212) |
| sesterstatin 2 (CHEBI:66476) is a organic heteropentacyclic compound (CHEBI:38164) |
| sesterstatin 2 (CHEBI:66476) is a primary alcohol (CHEBI:15734) |
| sesterstatin 2 (CHEBI:66476) is a scalarane sesterterpenoid (CHEBI:59370) |
| sesterstatin 2 (CHEBI:66476) is a secondary alcohol (CHEBI:35681) |
| sesterstatin 2 (CHEBI:66476) is a terpene lactone (CHEBI:37668) |
| sesterstatin 2 (CHEBI:66476) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (5aS,5bR,7aR,8S,11aR,11bR,13R,13aS)-13-hydroxy-8-(hydroxymethyl)-5b,8,11a,13a-tetramethyl-4,5,5a,5b,6,7,7a,8,9,10,11,11a,11b,12,13,13a-hexadecahydrochryseno[1,2-c]furan-1(3H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8043361 | Reaxys |
| Citations |
|---|