EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O2 |
| Net Charge | 0 |
| Average Mass | 236.355 |
| Monoisotopic Mass | 236.17763 |
| SMILES | [H][C@@]12C[C@H](C(=C)C)CCC(COO)=C1CC[C@@H]2C |
| InChI | InChI=1S/C15H24O2/c1-10(2)12-5-6-13(9-17-16)14-7-4-11(3)15(14)8-12/h11-12,15-16H,1,4-9H2,2-3H3/t11-,12+,15-/m0/s1 |
| InChIKey | OYLVRNLKRWKWJA-ZOWXZIJZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pogostemon cablin (ncbitaxon:28511) | whole plant (BTO:0001461) | PubMed (15577255) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| Application: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15α-hydroperoxy-guaia-1(10),11-diene (CHEBI:66474) has role metabolite (CHEBI:25212) |
| 15α-hydroperoxy-guaia-1(10),11-diene (CHEBI:66474) has role trypanocidal drug (CHEBI:36335) |
| 15α-hydroperoxy-guaia-1(10),11-diene (CHEBI:66474) is a guaiane sesquiterpenoid (CHEBI:36744) |
| IUPAC Name |
|---|
| [(1S,7R,8aS)-1-methyl-7-(prop-1-en-2-yl)-1,2,3,5,6,7,8,8a-octahydroazulen-4-yl]methyl hydroperoxide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9928305 | Reaxys |
| Citations |
|---|