EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O2 |
| Net Charge | 0 |
| Average Mass | 236.355 |
| Monoisotopic Mass | 236.17763 |
| SMILES | [H][C@@]12C[C@H](C(=C)C)CCC(=C)[C@]1(OO)CC[C@@H]2C |
| InChI | InChI=1S/C15H24O2/c1-10(2)13-6-5-12(4)15(17-16)8-7-11(3)14(15)9-13/h11,13-14,16H,1,4-9H2,2-3H3/t11-,13+,14-,15+/m0/s1 |
| InChIKey | LSSAEGXLQBRSBC-PMOUVXMZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pogostemon cablin (ncbitaxon:28511) | whole plant (BTO:0001461) | PubMed (15577255) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| Application: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1α-hydroperoxy-guaia-10(15),11-diene (CHEBI:66473) has role metabolite (CHEBI:25212) |
| 1α-hydroperoxy-guaia-10(15),11-diene (CHEBI:66473) has role trypanocidal drug (CHEBI:36335) |
| 1α-hydroperoxy-guaia-10(15),11-diene (CHEBI:66473) is a guaiane sesquiterpenoid (CHEBI:36744) |
| 1α-hydroperoxy-guaia-10(15),11-diene (CHEBI:66473) is a peroxol (CHEBI:35924) |
| IUPAC Name |
|---|
| (1S,3aS,7R,8aS)-1-methyl-4-methylidene-7-(prop-1-en-2-yl)octahydroazulen-3a(1H)-yl hydroperoxide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9928499 | Reaxys |
| Citations |
|---|