EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O2 |
| Net Charge | 0 |
| Average Mass | 236.355 |
| Monoisotopic Mass | 236.17763 |
| SMILES | [H][C@@]12C[C@H](C(=C)C)CC[C@@](C)(OO)C1=CC[C@@H]2C |
| InChI | InChI=1S/C15H24O2/c1-10(2)12-7-8-15(4,17-16)14-6-5-11(3)13(14)9-12/h6,11-13,16H,1,5,7-9H2,2-4H3/t11-,12+,13-,15+/m0/s1 |
| InChIKey | WVEJIBNZNZLFEF-SFDCQRBFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pogostemon cablin (ncbitaxon:28511) | whole plant (BTO:0001461) | PubMed (15577255) |
| Roles Classification |
|---|
| Biological Roles: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10α-hydroperoxy-guaia-1,11-diene (CHEBI:66472) has role metabolite (CHEBI:25212) |
| 10α-hydroperoxy-guaia-1,11-diene (CHEBI:66472) has role trypanocidal drug (CHEBI:36335) |
| 10α-hydroperoxy-guaia-1,11-diene (CHEBI:66472) is a guaiane sesquiterpenoid (CHEBI:36744) |
| 10α-hydroperoxy-guaia-1,11-diene (CHEBI:66472) is a peroxol (CHEBI:35924) |
| IUPAC Name |
|---|
| (1S,4R,7R,8aS)-1,4-dimethyl-7-(prop-1-en-2-yl)-1,2,4,5,6,7,8,8a-octahydroazulen-4-yl hydroperoxide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9925408 | Reaxys |
| Citations |
|---|