EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H24O9 |
| Net Charge | 0 |
| Average Mass | 528.513 |
| Monoisotopic Mass | 528.14203 |
| SMILES | Oc1ccc([C@H]2Oc3c(c(O)cc4c3[C@H]3C[C@](c5ccc(O)cc5)(Oc5cc(O)cc(O)c53)O4)C[C@H]2O)cc1 |
| InChI | InChI=1S/C30H24O9/c31-16-5-1-14(2-6-16)28-23(36)11-19-21(34)12-25-27(29(19)37-28)20-13-30(39-25,15-3-7-17(32)8-4-15)38-24-10-18(33)9-22(35)26(20)24/h1-10,12,20,23,28,31-36H,11,13H2/t20?,23-,28-,30+/m1/s1 |
| InChIKey | BHGCRZWUKWPRDM-TZVIJXGFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ephedra sinica (ncbitaxon:33152) | root (BTO:0001188) | PubMed (18975262) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mahuannin D (CHEBI:6647) has role plant metabolite (CHEBI:76924) |
| mahuannin D (CHEBI:6647) is a hydroxyflavan (CHEBI:72010) |
| mahuannin D (CHEBI:6647) is a proanthocyanidin (CHEBI:26267) |
| IUPAC Name |
|---|
| (2R,3R,8S)-2,8-bis(4-hydroxyphenyl)-3,4-dihydro-2H,8H,14H-8,14-methano-1,7,9-trioxabenzo[6,7]cycloocta[1,2-a]naphthalene-3,5,11,13-tetrol |
| Synonym | Source |
|---|---|
| ent-Apigeniflavan-(2alpha->7,4alpha->8)-epiafzelechin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C10234 | KEGG COMPOUND |
| C00002930 | KNApSAcK |
| LMPK12030014 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6031443 | Reaxys |
| CAS:88010-42-8 | KEGG COMPOUND |
| Citations |
|---|