EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18O6 |
| Net Charge | 0 |
| Average Mass | 318.325 |
| Monoisotopic Mass | 318.11034 |
| SMILES | COc1cc2oc(=O)cc(COC(=O)C=C(C)C)c2cc1OC |
| InChI | InChI=1S/C17H18O6/c1-10(2)5-16(18)22-9-11-6-17(19)23-13-8-15(21-4)14(20-3)7-12(11)13/h5-8H,9H2,1-4H3 |
| InChIKey | FPXUNDFOZUOGBF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crinum latifolium (ncbitaxon:209099) | leaf (BTO:0000713) | PubMed (15595606) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | angiogenesis modulating agent An agent that modulates the physiologic angiogenesis process. This is accomplished by endogenous angiogenic proteins and a variety of other chemicals and pharmaceutical agents. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-senecioyloxymethyl-6,7-dimethoxycoumarin (CHEBI:66463) has functional parent 3-methylbut-2-enoic acid (CHEBI:37127) |
| 4-senecioyloxymethyl-6,7-dimethoxycoumarin (CHEBI:66463) has role angiogenesis modulating agent (CHEBI:50926) |
| 4-senecioyloxymethyl-6,7-dimethoxycoumarin (CHEBI:66463) has role metabolite (CHEBI:25212) |
| 4-senecioyloxymethyl-6,7-dimethoxycoumarin (CHEBI:66463) is a aromatic ether (CHEBI:35618) |
| 4-senecioyloxymethyl-6,7-dimethoxycoumarin (CHEBI:66463) is a coumarins (CHEBI:23403) |
| 4-senecioyloxymethyl-6,7-dimethoxycoumarin (CHEBI:66463) is a enoate ester (CHEBI:51702) |
| IUPAC Name |
|---|
| (6,7-dimethoxy-2-oxo-2H-chromen-4-yl)methyl 3-methylbut-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9211386 | Reaxys |
| Citations |
|---|