EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O5 |
| Net Charge | 0 |
| Average Mass | 340.375 |
| Monoisotopic Mass | 340.13107 |
| SMILES | CC(C)=CCOc1ccc([C@@H]2CC(=O)c3c(O)cc(O)cc3O2)cc1 |
| InChI | InChI=1S/C20H20O5/c1-12(2)7-8-24-15-5-3-13(4-6-15)18-11-17(23)20-16(22)9-14(21)10-19(20)25-18/h3-7,9-10,18,21-22H,8,11H2,1-2H3/t18-/m0/s1 |
| InChIKey | GYSDUVRPSWKYDJ-SFHVURJKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Monotes engleri (IPNI:321075-1) | leaf (BTO:0000713) | DOI (10.1002/hlca.19980810325) | |
| Selinum vaginatum (ncbitaxon:239673) | - | DOI (10.1016/S0040-4039(00)71577-2) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| selinone (CHEBI:66460) has functional parent (S)-naringenin (CHEBI:17846) |
| selinone (CHEBI:66460) has role antifungal agent (CHEBI:35718) |
| selinone (CHEBI:66460) has role plant metabolite (CHEBI:76924) |
| selinone (CHEBI:66460) is a (2S)-flavan-4-one (CHEBI:140377) |
| selinone (CHEBI:66460) is a aromatic ether (CHEBI:35618) |
| selinone (CHEBI:66460) is a dihydroxyflavanone (CHEBI:38749) |
| IUPAC Name |
|---|
| (2S)-5,7-dihydroxy-2-{4-[(3-methylbut-2-en-1-yl)oxy]phenyl}-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 4'-O-prenylnaringenin | HMDB |
| 5,7-dihydroxy-4'-prenyloxyflavanone | ChEBI |
| archangelone | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0037585 | HMDB |
| LMPK12140278 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20282948 | Reaxys |
| CAS:14117-54-5 | ChemIDplus |
| Citations |
|---|