EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O2 |
| Net Charge | 0 |
| Average Mass | 302.458 |
| Monoisotopic Mass | 302.22458 |
| SMILES | [H][C@]12CC[C@](C)(C=C)CC1=CC[C@@H](C(=C)C)[C@]2(C)CCC(=O)O |
| InChI | InChI=1S/C20H30O2/c1-6-19(4)11-9-17-15(13-19)7-8-16(14(2)3)20(17,5)12-10-18(21)22/h6-7,16-17H,1-2,8-13H2,3-5H3,(H,21,22)/t16-,17-,19-,20-/m0/s1 |
| InChIKey | XQZUWQQUDZZOHA-ZULIPRJHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salvia cinnabarina (ncbitaxon:933125) | leaf (BTO:0000713) | PubMed (11301863) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-secoisopimara-4(18),7,15-triene-3-oic acid (CHEBI:66459) has role antibacterial agent (CHEBI:33282) |
| 3,4-secoisopimara-4(18),7,15-triene-3-oic acid (CHEBI:66459) has role antispasmodic drug (CHEBI:53784) |
| 3,4-secoisopimara-4(18),7,15-triene-3-oic acid (CHEBI:66459) has role metabolite (CHEBI:25212) |
| 3,4-secoisopimara-4(18),7,15-triene-3-oic acid (CHEBI:66459) is a carbobicyclic compound (CHEBI:36785) |
| 3,4-secoisopimara-4(18),7,15-triene-3-oic acid (CHEBI:66459) is a diterpenoid (CHEBI:23849) |
| 3,4-secoisopimara-4(18),7,15-triene-3-oic acid (CHEBI:66459) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-[(1S,2S,6S,8aS)-6-ethenyl-1,6-dimethyl-2-(prop-1-en-2-yl)-1,2,3,5,6,7,8,8a-octahydronaphthalen-1-yl]propanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22892163 | Reaxys |
| Citations |
|---|