EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O2 |
| Net Charge | 0 |
| Average Mass | 302.458 |
| Monoisotopic Mass | 302.22458 |
| SMILES | [H][C@]12CC[C@](C)(C=C)CC1=CC[C@@H](C(=C)C)[C@]2(C)CCC(=O)O |
| InChI | InChI=1S/C20H30O2/c1-6-19(4)11-9-17-15(13-19)7-8-16(14(2)3)20(17,5)12-10-18(21)22/h6-7,16-17H,1-2,8-13H2,3-5H3,(H,21,22)/t16-,17-,19-,20-/m0/s1 |
| InChIKey | XQZUWQQUDZZOHA-ZULIPRJHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salvia cinnabarina (ncbitaxon:933125) | leaf (BTO:0000713) | PubMed (11301863) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-secoisopimara-4(18),7,15-triene-3-oic acid (CHEBI:66459) has role antibacterial agent (CHEBI:33282) |
| 3,4-secoisopimara-4(18),7,15-triene-3-oic acid (CHEBI:66459) has role antispasmodic drug (CHEBI:53784) |
| 3,4-secoisopimara-4(18),7,15-triene-3-oic acid (CHEBI:66459) has role metabolite (CHEBI:25212) |
| 3,4-secoisopimara-4(18),7,15-triene-3-oic acid (CHEBI:66459) is a carbobicyclic compound (CHEBI:36785) |
| 3,4-secoisopimara-4(18),7,15-triene-3-oic acid (CHEBI:66459) is a diterpenoid (CHEBI:23849) |
| 3,4-secoisopimara-4(18),7,15-triene-3-oic acid (CHEBI:66459) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-[(1S,2S,6S,8aS)-6-ethenyl-1,6-dimethyl-2-(prop-1-en-2-yl)-1,2,3,5,6,7,8,8a-octahydronaphthalen-1-yl]propanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22892163 | Reaxys |
| Citations |
|---|