EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H30O4 |
| Net Charge | 0 |
| Average Mass | 298.423 |
| Monoisotopic Mass | 298.21441 |
| SMILES | CCCCCCCCCC/C=C(/C(=O)OC)[C@H](O)C(C)=O |
| InChI | InChI=1S/C17H30O4/c1-4-5-6-7-8-9-10-11-12-13-15(17(20)21-3)16(19)14(2)18/h13,16,19H,4-12H2,1-3H3/b15-13+/t16-/m1/s1 |
| InChIKey | BEYWPGROMZUINL-QJPKHSJYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lindera aggregata (ncbitaxon:545644) | leaf (BTO:0000713) | PubMed (17999353) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| secoaggregatalactone A (CHEBI:66458) has role antineoplastic agent (CHEBI:35610) |
| secoaggregatalactone A (CHEBI:66458) has role metabolite (CHEBI:25212) |
| secoaggregatalactone A (CHEBI:66458) is a enoate ester (CHEBI:51702) |
| secoaggregatalactone A (CHEBI:66458) is a ketone (CHEBI:17087) |
| secoaggregatalactone A (CHEBI:66458) is a secondary alcohol (CHEBI:35681) |
| secoaggregatalactone A (CHEBI:66458) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| methyl (2E)-2-[(1S)-1-hydroxy-2-oxopropyl]tridec-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15798901 | Reaxys |
| Citations |
|---|