EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C51H69N7O7 |
| Net Charge | 0 |
| Average Mass | 892.155 |
| Monoisotopic Mass | 891.52585 |
| SMILES | [H][C@]12C(=O)N(C)[C@@H](CC(C)C)C(=O)NC(C)(C)C(=O)N[C@@H](Cc3ccccc3)C(=O)N(C)[C@@H](Cc3ccccc3)C(=O)N[C@@H](Cc3ccccc3)C(=O)N[C@@H](CC(C)C)C(=O)N1CC[C@@H]2C |
| InChI | InChI=1S/C51H69N7O7/c1-32(2)27-39-48(63)58-26-25-34(5)43(58)49(64)57(9)41(28-33(3)4)46(61)55-51(6,7)50(65)54-40(30-36-21-15-11-16-22-36)47(62)56(8)42(31-37-23-17-12-18-24-37)45(60)52-38(44(59)53-39)29-35-19-13-10-14-20-35/h10-24,32-34,38-43H,25-31H2,1-9H3,(H,52,60)(H,53,59)(H,54,65)(H,55,61)/t34-,38-,39-,40-,41-,42-,43-/m0/s1 |
| InChIKey | BZXAVUYDKXXNPV-DKTNFYNISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scytalidium (ncbitaxon:5538) | - | PubMed (14604342) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| scytalidamide B (CHEBI:66457) has role antineoplastic agent (CHEBI:35610) |
| scytalidamide B (CHEBI:66457) has role metabolite (CHEBI:25212) |
| scytalidamide B (CHEBI:66457) is a homodetic cyclic peptide (CHEBI:24613) |
| scytalidamide B (CHEBI:66457) is a macrocycle (CHEBI:51026) |
| IUPAC Name |
|---|
| cyclo[2-methyl-D-alanyl-L-phenylalanyl-N-methyl-L-phenylalanyl-L-phenylalanyl-L-leucyl-(3S)-3-methyl-L-prolyl-N-methyl-L-leucyl] |
| Synonym | Source |
|---|---|
| (3S,9S,12S,15S,18S,23S,23aS)-9,12,15-tribenzyl-2,6,6,11,23-pentamethyl-3,18-bis(2-methylpropyl)hexadecahydro-1H-pyrrolo[1,2-a][1,4,7,10,13,16,19]heptaazacyclohenicosine-1,4,7,10,13,16,19-heptone | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9686009 | Reaxys |
| Citations |
|---|