EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H41NO9 |
| Net Charge | 0 |
| Average Mass | 595.689 |
| Monoisotopic Mass | 595.27813 |
| SMILES | [H][C@]12CCC=C(C)[C@]1(C)[C@@H](OC(=O)c1cccnc1)[C@H](OC(=O)C(OC(C)=O)C(C)C)[C@](C)(O)[C@]2(C)/C=C/C1=CC(=O)OC1 |
| InChI | InChI=1S/C33H41NO9/c1-19(2)26(41-21(4)35)30(38)43-28-27(42-29(37)23-11-9-15-34-17-23)32(6)20(3)10-8-12-24(32)31(5,33(28,7)39)14-13-22-16-25(36)40-18-22/h9-11,13-17,19,24,26-28,39H,8,12,18H2,1-7H3/b14-13+/t24-,26?,27+,28+,31-,32+,33+/m1/s1 |
| InChIKey | QLQRVRCHRRIMMB-ZDYHSNSLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scutellaria barbata (ncbitaxon:396367) | aerial part (BTO:0001658) | PubMed (18239311) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Scutebarbatine L(rel) (CHEBI:66452) has role metabolite (CHEBI:25212) |
| Scutebarbatine L(rel) (CHEBI:66452) is a diterpene lactone (CHEBI:49193) |
| Citations |
|---|