EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30O6 |
| Net Charge | 0 |
| Average Mass | 414.498 |
| Monoisotopic Mass | 414.20424 |
| SMILES | COc1cc(OC)c([C@H]2c3c(c(OC)cc(OC)c3OC)C=C(C)[C@@H]2C)cc1OC |
| InChI | InChI=1S/C24H30O6/c1-13-9-15-18(26-4)12-21(29-7)24(30-8)23(15)22(14(13)2)16-10-19(27-5)20(28-6)11-17(16)25-3/h9-12,14,22H,1-8H3/t14-,22-/m0/s1 |
| InChIKey | MWJAXRZVJODRGN-FPTDNZKUSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| magnoshinin (CHEBI:6645) has role anti-inflammatory agent (CHEBI:67079) |
| magnoshinin (CHEBI:6645) has role metabolite (CHEBI:25212) |
| magnoshinin (CHEBI:6645) is a methoxybenzenes (CHEBI:51683) |
| magnoshinin (CHEBI:6645) is a naphthalenes (CHEBI:25477) |
| magnoshinin (CHEBI:6645) is a neolignan (CHEBI:25497) |
| IUPAC Name |
|---|
| (1S,2R)-5,7,8-trimethoxy-2,3-dimethyl-1-(2,4,5-trimethoxyphenyl)-1,2-dihydronaphthalene |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4592047 | Reaxys |
| CAS:86702-02-5 | ChemIDplus |
| CAS:86702-02-5 | KEGG COMPOUND |
| Citations |
|---|