EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H41NO8 |
| Net Charge | 0 |
| Average Mass | 543.657 |
| Monoisotopic Mass | 543.28322 |
| SMILES | [H][C@]12C[C@H](OCC)O[C@@]1([H])O[C@]([H])([C@@]1(C)[C@H](C)C[C@H](OC(=O)c3cccnc3)[C@@]3(COC(C)=O)[C@]4(CCC[C@]13[H])CO4)C2 |
| InChI | InChI=1S/C30H41NO8/c1-5-34-25-14-21-13-23(38-27(21)39-25)28(4)18(2)12-24(37-26(33)20-8-7-11-31-15-20)30(17-35-19(3)32)22(28)9-6-10-29(30)16-36-29/h7-8,11,15,18,21-25,27H,5-6,9-10,12-14,16-17H2,1-4H3/t18-,21+,22-,23+,24+,25-,27-,28+,29+,30+/m1/s1 |
| InChIKey | QKISVSHUNJJKNY-MSTMNAHCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scutellaria barbata (ncbitaxon:396367) | aerial part (BTO:0001658) | PubMed (18239311) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Scutebarbatine I(rel) (CHEBI:66449) has role metabolite (CHEBI:25212) |
| Scutebarbatine I(rel) (CHEBI:66449) is a aromatic carboxylic acid (CHEBI:33859) |
| Scutebarbatine I(rel) (CHEBI:66449) is a pyridines (CHEBI:26421) |
| Citations |
|---|