EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H31NO7 |
| Net Charge | 0 |
| Average Mass | 469.534 |
| Monoisotopic Mass | 469.21005 |
| SMILES | [H][C@]12CCC=C(C)[C@]1(C)[C@@H](OC(=O)c1cccnc1)[C@H](O)[C@](C)(O)[C@]2(C)[C@@]1([H])CC2=C(O1)C(=O)OC2 |
| InChI | InChI=1S/C26H31NO7/c1-14-7-5-9-17-24(14,2)21(34-22(29)15-8-6-10-27-12-15)20(28)26(4,31)25(17,3)18-11-16-13-32-23(30)19(16)33-18/h6-8,10,12,17-18,20-21,28,31H,5,9,11,13H2,1-4H3/t17-,18+,20-,21-,24-,25-,26-/m0/s1 |
| InChIKey | ADBRHQRSKHISPR-JYNQJKKPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scutellaria barbata (ncbitaxon:396367) | aerial part (BTO:0001658) | PubMed (17666848) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| scutebarbatine H (CHEBI:66448) is a diterpene alkaloid (CHEBI:23847) |
| scutebarbatine H (CHEBI:66448) is a diterpene lactone (CHEBI:49193) |
| IUPAC Name |
|---|
| (1R,2S,3R,4S,4aS,8aR)-2,3-dihydroxy-3,4,8,8a-tetramethyl-4-[(2R)-6-oxo-2,3,4,6-tetrahydrofuro[3,4-b]furan-2-yl]-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl pyridine-3-carboxylate |
| Citations |
|---|