EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H37NO9 |
| Net Charge | 0 |
| Average Mass | 555.624 |
| Monoisotopic Mass | 555.24683 |
| SMILES | [H][C@]12CCC=C(C)[C@]1(C)[C@@H](OC(=O)c1cccnc1)[C@H](OC(C)=O)[C@]1(C)O[C@@]3(COC(=O)C3)C[C@H](OC(C)=O)[C@]21C |
| InChI | InChI=1S/C30H37NO9/c1-17-9-7-11-21-27(17,4)24(39-26(35)20-10-8-12-31-15-20)25(38-19(3)33)29(6)28(21,5)22(37-18(2)32)13-30(40-29)14-23(34)36-16-30/h8-10,12,15,21-22,24-25H,7,11,13-14,16H2,1-6H3/t21-,22-,24-,25-,27-,28-,29-,30-/m0/s1 |
| InChIKey | PGDYKRFBYIVCFR-VCKVKWFOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scutellaria barbata (ncbitaxon:396367) | whole plant (BTO:0001461) | PubMed (16755060) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| scutebarbatine F (CHEBI:66446) has role antineoplastic agent (CHEBI:35610) |
| scutebarbatine F (CHEBI:66446) has role plant metabolite (CHEBI:76924) |
| scutebarbatine F (CHEBI:66446) is a acetate ester (CHEBI:47622) |
| scutebarbatine F (CHEBI:66446) is a diterpene alkaloid (CHEBI:23847) |
| scutebarbatine F (CHEBI:66446) is a organic heterotetracyclic compound (CHEBI:38163) |
| scutebarbatine F (CHEBI:66446) is a oxaspiro compound (CHEBI:37948) |
| scutebarbatine F (CHEBI:66446) is a pyridine alkaloid (CHEBI:26416) |
| IUPAC Name |
|---|
| rel-(1S,3S,4aR,5S,6R,6aR,10aS,10bS)-1,5-bis(acetyloxy)-4a,6a,7,10b-tetramethyl-5'-oxo-1,2,4',4a,5,5',6,6a,9,10,10a,10b-dodecahydrospiro[benzo[f]chromene-3,3'-furan]-6-yl pyridine-3-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| C00031329 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10407265 | Reaxys |
| Citations |
|---|